|
Name |
Asperphenalenone A
|
| Molecular Formula | C35H44O7 | |
| IUPAC Name* |
(2S)-2,4,6,9-tetrahydroxy-2-[(2E,6E,10Z)-11-(hydroxymethyl)-3,7,15-trimethylhexadeca-2,6,10,14-tetraenyl]-5,7-dimethylphenalene-1,3-dione
|
|
| SMILES |
CC1=CC(=C2C3=C1C(=C(C(=C3C(=O)[C@@](C2=O)(C/C=C(\C)/CC/C=C(\C)/CC/C=C(/CCC=C(C)C)\CO)O)O)C)O)O
|
|
| InChI |
InChI=1S/C35H44O7/c1-20(2)10-7-14-25(19-36)15-9-13-21(3)11-8-12-22(4)16-17-35(42)33(40)28-26(37)18-23(5)27-29(28)30(34(35)41)32(39)24(6)31(27)38/h10-11,15-16,18,36-39,42H,7-9,12-14,17,19H2,1-6H3/b21-11+,22-16+,25-15-/t35-/m0/s1
|
|
| InChIKey |
CSQKRBFZSGLNBY-KGRLNHTJSA-N
|
|
| Synonyms |
Asperphenalenone A; CHEMBL4171539; (2S)-2,4,6,9-tetrahydroxy-2-[(2E,6E,10Z)-11-(hydroxymethyl)-3,7,15-trimethyl-hexadeca-2,6,10,14-tetraenyl]-5,7-dimethyl-phenalene-1,3-dione
|
|
| CAS | NA | |
| PubChem CID | 134816135 | |
| ChEMBL ID | CHEMBL4171539 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 576.7 | ALogp: | 8.9 |
| HBD: | 5 | HBA: | 7 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 135.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 42 | QED Weighted: | 0.133 |
| Caco-2 Permeability: | -4.893 | MDCK Permeability: | 0.00000885 |
| Pgp-inhibitor: | 0.555 | Pgp-substrate: | 0.996 |
| Human Intestinal Absorption (HIA): | 0.24 | 20% Bioavailability (F20%): | 0.705 |
| 30% Bioavailability (F30%): | 0.13 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 96.14% |
| Volume Distribution (VD): | 0.408 | Fu: | 0.69% |
| CYP1A2-inhibitor: | 0.466 | CYP1A2-substrate: | 0.288 |
| CYP2C19-inhibitor: | 0.539 | CYP2C19-substrate: | 0.114 |
| CYP2C9-inhibitor: | 0.894 | CYP2C9-substrate: | 0.804 |
| CYP2D6-inhibitor: | 0.925 | CYP2D6-substrate: | 0.129 |
| CYP3A4-inhibitor: | 0.34 | CYP3A4-substrate: | 0.208 |
| Clearance (CL): | 1.898 | Half-life (T1/2): | 0.218 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.539 |
| Drug-inuced Liver Injury (DILI): | 0.403 | AMES Toxicity: | 0.079 |
| Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.913 |
| Skin Sensitization: | 0.925 | Carcinogencity: | 0.094 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.467 |
| Respiratory Toxicity: | 0.741 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003114 | ![]() |
0.797 | D05XQE | ![]() |
0.479 | ||
| ENC003842 | ![]() |
0.706 | D09XWD | ![]() |
0.391 | ||
| ENC003496 | ![]() |
0.706 | D03VFL | ![]() |
0.345 | ||
| ENC005341 | ![]() |
0.674 | D01ZUA | ![]() |
0.265 | ||
| ENC005340 | ![]() |
0.627 | D0WY9N | ![]() |
0.256 | ||
| ENC005338 | ![]() |
0.617 | D0FX2Q | ![]() |
0.224 | ||
| ENC005339 | ![]() |
0.597 | D08FPM | ![]() |
0.217 | ||
| ENC005337 | ![]() |
0.585 | D0Q0PR | ![]() |
0.215 | ||
| ENC003495 | ![]() |
0.562 | D00FSV | ![]() |
0.214 | ||
| ENC006119 | ![]() |
0.414 | D0G4OD | ![]() |
0.205 | ||