|
Name |
(-)-Asperteretone E
|
| Molecular Formula | C23H22O6 | |
| IUPAC Name* |
3-[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]-4-(4-hydroxyphenyl)-2-methoxy-2H-furan-5-one
|
|
| SMILES |
COC1OC(=O)C(c2ccc(O)cc2)=C1C(=O)c1ccc(O)c(CC=C(C)C)c1
|
|
| InChI |
InChI=1S/C23H22O6/c1-13(2)4-5-15-12-16(8-11-18(15)25)21(26)20-19(22(27)29-23(20)28-3)14-6-9-17(24)10-7-14/h4,6-12,23-25H,5H2,1-3H3/t23-/m1/s1
|
|
| InChIKey |
INHYMWNMRCHFNR-HSZRJFAPSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 394.42 | ALogp: | 3.8 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 93.1 | Aromatic Rings: | 3 |
| Heavy Atoms: | 29 | QED Weighted: | 0.427 |
| Caco-2 Permeability: | -4.723 | MDCK Permeability: | 0.00001370 |
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.125 |
| Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 100.86% |
| Volume Distribution (VD): | 0.463 | Fu: | 1.16% |
| CYP1A2-inhibitor: | 0.904 | CYP1A2-substrate: | 0.129 |
| CYP2C19-inhibitor: | 0.795 | CYP2C19-substrate: | 0.052 |
| CYP2C9-inhibitor: | 0.753 | CYP2C9-substrate: | 0.858 |
| CYP2D6-inhibitor: | 0.598 | CYP2D6-substrate: | 0.422 |
| CYP3A4-inhibitor: | 0.46 | CYP3A4-substrate: | 0.16 |
| Clearance (CL): | 11.307 | Half-life (T1/2): | 0.418 |
| hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.833 |
| Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.038 |
| Rat Oral Acute Toxicity: | 0.181 | Maximum Recommended Daily Dose: | 0.03 |
| Skin Sensitization: | 0.223 | Carcinogencity: | 0.469 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.162 |
| Respiratory Toxicity: | 0.23 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005298 | ![]() |
1.000 | D0Q0PR | ![]() |
0.372 | ||
| ENC004319 | ![]() |
0.736 | D0Y2NE | ![]() |
0.308 | ||
| ENC002729 | ![]() |
0.587 | D09ZQN | ![]() |
0.308 | ||
| ENC000875 | ![]() |
0.587 | D01XBA | ![]() |
0.297 | ||
| ENC003356 | ![]() |
0.582 | D0R1RS | ![]() |
0.296 | ||
| ENC003113 | ![]() |
0.570 | D0Y7PG | ![]() |
0.288 | ||
| ENC005358 | ![]() |
0.558 | D0J7RK | ![]() |
0.279 | ||
| ENC003410 | ![]() |
0.555 | D06TJJ | ![]() |
0.277 | ||
| ENC005357 | ![]() |
0.520 | D0U1OM | ![]() |
0.274 | ||
| ENC002452 | ![]() |
0.495 | D0Q9ON | ![]() |
0.272 | ||