|
Name |
Butyrolactone i
|
| Molecular Formula | C24H24O7 | |
| IUPAC Name* |
methyl (2R)-4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate
|
|
| SMILES |
CC(=CCC1=C(C=CC(=C1)C[C@@]2(C(=C(C(=O)O2)O)C3=CC=C(C=C3)O)C(=O)OC)O)C
|
|
| InChI |
InChI=1S/C24H24O7/c1-14(2)4-6-17-12-15(5-11-19(17)26)13-24(23(29)30-3)20(21(27)22(28)31-24)16-7-9-18(25)10-8-16/h4-5,7-12,25-27H,6,13H2,1-3H3/t24-/m1/s1
|
|
| InChIKey |
NGOLMNWQNHWEKU-XMMPIXPASA-N
|
|
| Synonyms |
butyrolactone i; CHEMBL517026; 87414-49-1; (+)-3''-Dimethylallyl-butyrolactone II; (2R)-2,5-Dihydro-4-hydroxy-2-[[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methyl]-3-(4-hydroxyphenyl)-5-oxo-2-furancarboxylic acid, methyl ester; 4'-O-Demethylversicolactone D; MEGxm0_000072; SCHEMBL15162502; ACon0_000841; ACon1_002427; DTXSID50236337; BDBM50453566; ZINC27415691; CCG-208782; NCGC00169858-01; NCGC00169858-03; HY-111237; CS-0034724; 2-(3-(3-Methyl-2-butenyl)-4-hydroxybenzyl)-3-(4-hydroxyphenyl)-4-hydroxy-5-oxo-2,5-dihydrofuran-2beta-carboxylic acid methyl ester; methyl (R)-4-hydroxy-2-(4-hydroxy-3-(3-methylbut-2-en-1-yl)benzyl)-3-(4-hydroxyphenyl)-5-oxo-2,5-dihydrofuran-2-carboxylate; NCGC00169858-03_C24H24O7_Methyl (2R)-4-hydroxy-2-[4-hydroxy-3-(3-methyl-2-buten-1-yl)benzyl]-3-(4-hydroxyphenyl)-5-oxo-2,5-dihydro-2-furancarboxylate
|
|
| CAS | 87414-49-1 | |
| PubChem CID | 123740 | |
| ChEMBL ID | CHEMBL517026 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 424.4 | ALogp: | 4.4 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 31 | QED Weighted: | 0.468 |
| Caco-2 Permeability: | -4.91 | MDCK Permeability: | 0.00001860 |
| Pgp-inhibitor: | 0.032 | Pgp-substrate: | 0.011 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.068 |
| 30% Bioavailability (F30%): | 0.834 |
| Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 98.80% |
| Volume Distribution (VD): | 0.455 | Fu: | 1.19% |
| CYP1A2-inhibitor: | 0.332 | CYP1A2-substrate: | 0.48 |
| CYP2C19-inhibitor: | 0.956 | CYP2C19-substrate: | 0.182 |
| CYP2C9-inhibitor: | 0.939 | CYP2C9-substrate: | 0.949 |
| CYP2D6-inhibitor: | 0.871 | CYP2D6-substrate: | 0.739 |
| CYP3A4-inhibitor: | 0.903 | CYP3A4-substrate: | 0.316 |
| Clearance (CL): | 15.321 | Half-life (T1/2): | 0.407 |
| hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.476 |
| Drug-inuced Liver Injury (DILI): | 0.737 | AMES Toxicity: | 0.091 |
| Rat Oral Acute Toxicity: | 0.442 | Maximum Recommended Daily Dose: | 0.187 |
| Skin Sensitization: | 0.167 | Carcinogencity: | 0.137 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.092 |
| Respiratory Toxicity: | 0.027 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002729 | ![]() |
1.000 | D0Q0PR | ![]() |
0.333 | ||
| ENC003113 | ![]() |
0.840 | D0J7RK | ![]() |
0.324 | ||
| ENC003410 | ![]() |
0.814 | D06KYN | ![]() |
0.304 | ||
| ENC002376 | ![]() |
0.755 | D0Q9ON | ![]() |
0.293 | ||
| ENC002552 | ![]() |
0.755 | D06TJJ | ![]() |
0.287 | ||
| ENC003721 | ![]() |
0.742 | D0Y2NE | ![]() |
0.282 | ||
| ENC002705 | ![]() |
0.740 | D0D1DI | ![]() |
0.281 | ||
| ENC005247 | ![]() |
0.680 | D04KJO | ![]() |
0.281 | ||
| ENC002571 | ![]() |
0.670 | D0Q1IT | ![]() |
0.281 | ||
| ENC005358 | ![]() |
0.670 | D04XEG | ![]() |
0.281 | ||