|
Name |
Sarocladic acid A
|
| Molecular Formula | C33H46O9 | |
| IUPAC Name* |
2-(6,16-diacetyloxy-4,8,10,14-tetramethyl-3,7-dioxo-5,6,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-hydroxy-6-methylheptanoicacid
|
|
| SMILES |
CC(=O)OC1CC2(C)C(CCC3C4(C)C=CC(=O)C(C)C4C(OC(C)=O)C(=O)C32C)C1=C(CCCC(C)(C)O)C(=O)O
|
|
| InChI |
InChI=1S/C33H46O9/c1-17-22(36)13-15-31(6)24-12-11-21-25(20(29(38)39)10-9-14-30(4,5)40)23(41-18(2)34)16-32(21,7)33(24,8)28(37)27(26(17)31)42-19(3)35/h13,15,17,21,23-24,26-27,40H,9-12,14,16H2,1-8H3,(H,38,39)/b25-20-/t17-,21+,23+,24+,26-,27+,31-,32+,33-/m1/s1
|
|
| InChIKey |
WLRJWQXWJBEULT-GAZAAFLYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 586.72 | ALogp: | 4.6 |
| HBD: | 2 | HBA: | 8 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 144.3 | Aromatic Rings: | 4 |
| Heavy Atoms: | 42 | QED Weighted: | 0.309 |
| Caco-2 Permeability: | -5.295 | MDCK Permeability: | 0.00002110 |
| Pgp-inhibitor: | 0.963 | Pgp-substrate: | 0.059 |
| Human Intestinal Absorption (HIA): | 0.476 | 20% Bioavailability (F20%): | 0.929 |
| 30% Bioavailability (F30%): | 0.537 |
| Blood-Brain-Barrier Penetration (BBB): | 0.901 | Plasma Protein Binding (PPB): | 87.90% |
| Volume Distribution (VD): | 0.47 | Fu: | 12.30% |
| CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.092 |
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.707 |
| CYP2C9-inhibitor: | 0.033 | CYP2C9-substrate: | 0.12 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.051 |
| CYP3A4-inhibitor: | 0.344 | CYP3A4-substrate: | 0.316 |
| Clearance (CL): | 2.105 | Half-life (T1/2): | 0.325 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.061 |
| Drug-inuced Liver Injury (DILI): | 0.374 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.955 | Maximum Recommended Daily Dose: | 0.672 |
| Skin Sensitization: | 0.028 | Carcinogencity: | 0.378 |
| Eye Corrosion: | 0.006 | Eye Irritation: | 0.036 |
| Respiratory Toxicity: | 0.967 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005236 | ![]() |
1.000 | D0X7XG | ![]() |
0.391 | ||
| ENC001480 | ![]() |
0.803 | D0G7KJ | ![]() |
0.291 | ||
| ENC005153 | ![]() |
0.790 | D01ZOG | ![]() |
0.276 | ||
| ENC005487 | ![]() |
0.784 | D0X2LV | ![]() |
0.271 | ||
| ENC003484 | ![]() |
0.715 | D09IEE | ![]() |
0.270 | ||
| ENC003780 | ![]() |
0.696 | D0F7NQ | ![]() |
0.269 | ||
| ENC002467 | ![]() |
0.630 | D08BDT | ![]() |
0.267 | ||
| ENC005155 | ![]() |
0.615 | D0H2MO | ![]() |
0.264 | ||
| ENC003848 | ![]() |
0.593 | D03SXE | ![]() |
0.261 | ||
| ENC003846 | ![]() |
0.540 | D09WYX | ![]() |
0.259 | ||