![]() |
Name |
16-O-propionyl-16-O-deacetylhelvolic acid
|
Molecular Formula | C34H48O8 | |
IUPAC Name* |
(2Z)-2-[(4S,5S,6S,8S,9S,10R,13R,14S,16S)-6-acetyloxy-4,8,10,14-tetramethyl-3,7-dioxo-16-propanoyloxy-2,4,5,6,9,11,12,13,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid
|
|
SMILES |
CCC(=O)O[C@H]\1C[C@]2([C@H](/C1=C(\CCC=C(C)C)/C(=O)O)CC[C@@H]3[C@@]2(C(=O)[C@H]([C@@H]4[C@@]3(CCC(=O)[C@H]4C)C)OC(=O)C)C)C
|
|
InChI |
InChI=1S/C34H48O8/c1-9-26(37)42-24-17-33(7)22(27(24)21(31(39)40)12-10-11-18(2)3)13-14-25-32(6)16-15-23(36)19(4)28(32)29(41-20(5)35)30(38)34(25,33)8/h11,19,22,24-25,28-29H,9-10,12-17H2,1-8H3,(H,39,40)/b27-21-/t19-,22+,24+,25+,28-,29+,32-,33+,34-/m1/s1
|
|
InChIKey |
KNJIRJDHNZZHGT-XARGSBJLSA-N
|
|
Synonyms |
16-O-propionyl-16-O-deacetylhelvolic acid
|
|
CAS | NA | |
PubChem CID | 139590098 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 584.7 | ALogp: | 5.4 |
HBD: | 1 | HBA: | 8 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 124.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 42 | QED Weighted: | 0.217 |
Caco-2 Permeability: | -5.299 | MDCK Permeability: | 0.00002820 |
Pgp-inhibitor: | 0.972 | Pgp-substrate: | 0.991 |
Human Intestinal Absorption (HIA): | 0.165 | 20% Bioavailability (F20%): | 0.032 |
30% Bioavailability (F30%): | 0.943 |
Blood-Brain-Barrier Penetration (BBB): | 0.964 | Plasma Protein Binding (PPB): | 95.40% |
Volume Distribution (VD): | 0.362 | Fu: | 4.79% |
CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.084 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.523 |
CYP2C9-inhibitor: | 0.025 | CYP2C9-substrate: | 0.071 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.037 |
CYP3A4-inhibitor: | 0.285 | CYP3A4-substrate: | 0.275 |
Clearance (CL): | 12.553 | Half-life (T1/2): | 0.277 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.168 |
Drug-inuced Liver Injury (DILI): | 0.755 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.952 | Maximum Recommended Daily Dose: | 0.073 |
Skin Sensitization: | 0.061 | Carcinogencity: | 0.475 |
Eye Corrosion: | 0.973 | Eye Irritation: | 0.089 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002467 | ![]() |
0.905 | D0X7XG | ![]() |
0.496 | ||
ENC005153 | ![]() |
0.756 | D09IEE | ![]() |
0.300 | ||
ENC001480 | ![]() |
0.713 | D0X2LV | ![]() |
0.285 | ||
ENC005487 | ![]() |
0.697 | D0H2MO | ![]() |
0.278 | ||
ENC003484 | ![]() |
0.635 | D09NNA | ![]() |
0.278 | ||
ENC003780 | ![]() |
0.626 | D01ZOG | ![]() |
0.274 | ||
ENC005155 | ![]() |
0.598 | D0X4RS | ![]() |
0.265 | ||
ENC005154 | ![]() |
0.593 | D05RXI | ![]() |
0.258 | ||
ENC005236 | ![]() |
0.593 | D08BDT | ![]() |
0.258 | ||
ENC001478 | ![]() |
0.496 | D08TEJ | ![]() |
0.255 |