|
Name |
10, 23-Dihydro-24,25 -dehydro-21–oxoaflavinine
|
| Molecular Formula | C28H37NO2 | |
| IUPAC Name* |
11-hydroxy-4-(1H-indol-3-yl)-5,7a,8-trimethyl-3-prop-1-en-2-yl-3,4,4a,5,6,7,8,9,10,11-decahydro-2H-benzo[j]naphthalen-1-one
|
|
| SMILES |
C=C(C)C1CC(=O)C23C(O)CCC(C)C2(C)CCC(C)C3C1c1c[nH]c2ccccc12
|
|
| InChI |
InChI=1S/C28H37NO2/c1-16(2)20-14-24(31)28-23(30)11-10-18(4)27(28,5)13-12-17(3)26(28)25(20)21-15-29-22-9-7-6-8-19(21)22/h6-9,15,17-18,20,23,25-26,29-30H,1,10-14H2,2-5H3/t17-,18?,20+,23?,25?,26?,27+,28?/m1/s1
|
|
| InChIKey |
CTCFXRNJXWQDJI-ITFHYUIISA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 419.61 | ALogp: | 6.2 |
| HBD: | 2 | HBA: | 2 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 53.1 | Aromatic Rings: | 5 |
| Heavy Atoms: | 31 | QED Weighted: | 0.565 |
| Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00001670 |
| Pgp-inhibitor: | 0.46 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.042 |
| 30% Bioavailability (F30%): | 0.177 |
| Blood-Brain-Barrier Penetration (BBB): | 0.834 | Plasma Protein Binding (PPB): | 95.73% |
| Volume Distribution (VD): | 1.393 | Fu: | 3.13% |
| CYP1A2-inhibitor: | 0.075 | CYP1A2-substrate: | 0.871 |
| CYP2C19-inhibitor: | 0.456 | CYP2C19-substrate: | 0.955 |
| CYP2C9-inhibitor: | 0.546 | CYP2C9-substrate: | 0.912 |
| CYP2D6-inhibitor: | 0.383 | CYP2D6-substrate: | 0.874 |
| CYP3A4-inhibitor: | 0.861 | CYP3A4-substrate: | 0.835 |
| Clearance (CL): | 15.112 | Half-life (T1/2): | 0.032 |
| hERG Blockers: | 0.078 | Human Hepatotoxicity (H-HT): | 0.418 |
| Drug-inuced Liver Injury (DILI): | 0.037 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.946 | Maximum Recommended Daily Dose: | 0.852 |
| Skin Sensitization: | 0.21 | Carcinogencity: | 0.051 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
| Respiratory Toxicity: | 0.949 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002422 | ![]() |
0.753 | D0K0KH | ![]() |
0.313 | ||
| ENC005120 | ![]() |
0.654 | D00YLW | ![]() |
0.300 | ||
| ENC002423 | ![]() |
0.504 | D0H4JM | ![]() |
0.288 | ||
| ENC003299 | ![]() |
0.434 | D0T7ZQ | ![]() |
0.280 | ||
| ENC002079 | ![]() |
0.393 | D04SFH | ![]() |
0.262 | ||
| ENC002294 | ![]() |
0.379 | D0V3ZA | ![]() |
0.259 | ||
| ENC003834 | ![]() |
0.375 | D0W2EK | ![]() |
0.259 | ||
| ENC001931 | ![]() |
0.371 | D06CWH | ![]() |
0.259 | ||
| ENC003933 | ![]() |
0.364 | D0U7GP | ![]() |
0.258 | ||
| ENC005406 | ![]() |
0.362 | D01JGV | ![]() |
0.258 | ||