![]() |
Name |
3b-hydroxy-4b-desoxypaxilline
|
Molecular Formula | C28H37NO2 | |
IUPAC Name* |
7-(2-hydroxypropan-2-yl)-1,2-dimethyl-22-azahexacyclo[12.10.0.02,11.05,10.016,23.017,21]tetracosa-9,16(23),17,19,21-pentaen-8-ol
|
|
SMILES |
CC(C)(O)C1CC2CCC3(C)C(CCC4Cc5c([nH]c6ccccc56)C43C)C2=CC1O
|
|
InChI |
InChI=1S/C28H37NO2/c1-26(2,31)22-13-16-11-12-27(3)21(19(16)15-24(22)30)10-9-17-14-20-18-7-5-6-8-23(18)29-25(20)28(17,27)4/h5-8,15-17,21-22,24,29-31H,9-14H2,1-4H3/t16-,17+,21+,22+,24-,27+,28-/m1/s1
|
|
InChIKey |
MNKIEVSGOFWDIK-FICGGCHZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 419.61 | ALogp: | 5.5 |
HBD: | 3 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 56.2 | Aromatic Rings: | 6 |
Heavy Atoms: | 31 | QED Weighted: | 0.519 |
Caco-2 Permeability: | -4.698 | MDCK Permeability: | 0.00001550 |
Pgp-inhibitor: | 0.811 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.245 |
30% Bioavailability (F30%): | 0.055 |
Blood-Brain-Barrier Penetration (BBB): | 0.852 | Plasma Protein Binding (PPB): | 97.36% |
Volume Distribution (VD): | 2.164 | Fu: | 1.52% |
CYP1A2-inhibitor: | 0.115 | CYP1A2-substrate: | 0.792 |
CYP2C19-inhibitor: | 0.274 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.344 | CYP2C9-substrate: | 0.93 |
CYP2D6-inhibitor: | 0.517 | CYP2D6-substrate: | 0.878 |
CYP3A4-inhibitor: | 0.659 | CYP3A4-substrate: | 0.766 |
Clearance (CL): | 7.455 | Half-life (T1/2): | 0.023 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.061 |
Drug-inuced Liver Injury (DILI): | 0.043 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.427 | Maximum Recommended Daily Dose: | 0.818 |
Skin Sensitization: | 0.027 | Carcinogencity: | 0.146 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.968 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005989 | ![]() |
0.776 | D0H4JM | ![]() |
0.328 | ||
ENC003172 | ![]() |
0.776 | D01JGV | ![]() |
0.286 | ||
ENC002951 | ![]() |
0.703 | D0U7GP | ![]() |
0.286 | ||
ENC002279 | ![]() |
0.673 | D0K0KH | ![]() |
0.254 | ||
ENC005405 | ![]() |
0.655 | D08QKJ | ![]() |
0.250 | ||
ENC004710 | ![]() |
0.630 | D02STN | ![]() |
0.246 | ||
ENC003933 | ![]() |
0.602 | D00YLW | ![]() |
0.246 | ||
ENC005990 | ![]() |
0.600 | D0Q6NZ | ![]() |
0.244 | ||
ENC000857 | ![]() |
0.582 | D05BTM | ![]() |
0.243 | ||
ENC002707 | ![]() |
0.573 | D0T2PL | ![]() |
0.243 |