![]() |
Name |
methyl ether of fusarubin
|
Molecular Formula | C16H14O7 | |
IUPAC Name* |
5,10-dihydroxy-7-methoxy-3-methyl-6,9-dioxo-1,4-dihydrobenzo[g]isochromene-3-carbaldehyde
|
|
SMILES |
COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)CC(C)(C=O)OC3
|
|
InChI |
InChI=1S/C16H14O7/c1-16(6-17)4-7-8(5-23-16)14(20)11-9(18)3-10(22-2)15(21)12(11)13(7)19/h3,6,19-20H,4-5H2,1-2H3
|
|
InChIKey |
KERCVMURHVYMPP-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 318.28 | ALogp: | 1.0 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 110.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.627 |
Caco-2 Permeability: | -5.43 | MDCK Permeability: | 0.00000437 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.117 | 20% Bioavailability (F20%): | 0.064 |
30% Bioavailability (F30%): | 0.039 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 81.53% |
Volume Distribution (VD): | 1.158 | Fu: | 10.84% |
CYP1A2-inhibitor: | 0.9 | CYP1A2-substrate: | 0.746 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.026 | CYP2C9-substrate: | 0.715 |
CYP2D6-inhibitor: | 0.096 | CYP2D6-substrate: | 0.124 |
CYP3A4-inhibitor: | 0.145 | CYP3A4-substrate: | 0.225 |
Clearance (CL): | 2.193 | Half-life (T1/2): | 0.849 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.27 |
Drug-inuced Liver Injury (DILI): | 0.18 | AMES Toxicity: | 0.614 |
Rat Oral Acute Toxicity: | 0.034 | Maximum Recommended Daily Dose: | 0.105 |
Skin Sensitization: | 0.521 | Carcinogencity: | 0.93 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.43 |
Respiratory Toxicity: | 0.918 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000709 | ![]() |
0.779 | D01XWG | ![]() |
0.289 | ||
ENC006087 | ![]() |
0.746 | D0C9XJ | ![]() |
0.282 | ||
ENC002308 | ![]() |
0.658 | D07VLY | ![]() |
0.282 | ||
ENC005119 | ![]() |
0.653 | D01XDL | ![]() |
0.280 | ||
ENC002036 | ![]() |
0.577 | D0T8EH | ![]() |
0.247 | ||
ENC000925 | ![]() |
0.566 | D0T5XN | ![]() |
0.243 | ||
ENC000334 | ![]() |
0.500 | D07IPB | ![]() |
0.227 | ||
ENC006088 | ![]() |
0.500 | D0C1SF | ![]() |
0.221 | ||
ENC005342 | ![]() |
0.481 | D07MGA | ![]() |
0.218 | ||
ENC005157 | ![]() |
0.469 | D06XZW | ![]() |
0.213 |