![]() |
Name |
Anhydrofusarubin
|
Molecular Formula | C15H12O6 | |
IUPAC Name* |
5,10-dihydroxy-7-methoxy-3-methyl-1H-benzo[g]isochromene-6,9-dione
|
|
SMILES |
CC1=CC2=C(CO1)C(=C3C(=O)C=C(C(=O)C3=C2O)OC)O
|
|
InChI |
InChI=1S/C15H12O6/c1-6-3-7-8(5-21-6)14(18)11-9(16)4-10(20-2)15(19)12(11)13(7)17/h3-4,17-18H,5H2,1-2H3
|
|
InChIKey |
ZFYMKRBESCDJHI-UHFFFAOYSA-N
|
|
Synonyms |
ANHYDROFUSARUBIN; 79383-28-1; 64421-39-2; 1H-Naphtho(2,3-c)pyran-5,10-dione, 6,9-dihydroxy-7-methoxy-3-methyl-; CHEMBL1224817; DTXSID10214676; 5,10-dihydroxy-7-methoxy-3-methyl-1H-benzo[g]isochromene-6,9-dione; 1H-Naphtho(2,3-c)pyran-6,9-dione, 5,10-dihydroxy-7-methoxy-3-methyl-; 3-Methyl-5,10-dihydroxy-7-methoxy-1H-naphtho[2,3-c]pyran-6,9-dione
|
|
CAS | 64421-39-2 | |
PubChem CID | 157509 | |
ChEMBL ID | CHEMBL1224817 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 288.25 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.771 |
Caco-2 Permeability: | -4.981 | MDCK Permeability: | 0.00000623 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.053 |
Human Intestinal Absorption (HIA): | 0.45 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.569 |
Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 89.52% |
Volume Distribution (VD): | 0.556 | Fu: | 15.25% |
CYP1A2-inhibitor: | 0.812 | CYP1A2-substrate: | 0.958 |
CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.073 |
CYP2C9-inhibitor: | 0.55 | CYP2C9-substrate: | 0.618 |
CYP2D6-inhibitor: | 0.423 | CYP2D6-substrate: | 0.27 |
CYP3A4-inhibitor: | 0.107 | CYP3A4-substrate: | 0.097 |
Clearance (CL): | 6.527 | Half-life (T1/2): | 0.796 |
hERG Blockers: | 0.048 | Human Hepatotoxicity (H-HT): | 0.056 |
Drug-inuced Liver Injury (DILI): | 0.84 | AMES Toxicity: | 0.279 |
Rat Oral Acute Toxicity: | 0.227 | Maximum Recommended Daily Dose: | 0.86 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.405 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.886 |
Respiratory Toxicity: | 0.162 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005119 | ![]() |
0.606 | D01XWG | ![]() |
0.280 | ||
ENC000709 | ![]() |
0.589 | D07VLY | ![]() |
0.273 | ||
ENC005095 | ![]() |
0.566 | D0C9XJ | ![]() |
0.273 | ||
ENC006087 | ![]() |
0.566 | D01XDL | ![]() |
0.270 | ||
ENC002308 | ![]() |
0.547 | D06GCK | ![]() |
0.248 | ||
ENC005342 | ![]() |
0.534 | D07MGA | ![]() |
0.242 | ||
ENC000334 | ![]() |
0.534 | D0T8EH | ![]() |
0.238 | ||
ENC006088 | ![]() |
0.534 | D0T5XN | ![]() |
0.235 | ||
ENC002036 | ![]() |
0.532 | D02PMO | ![]() |
0.233 | ||
ENC003030 | ![]() |
0.521 | D0C1SF | ![]() |
0.232 |