|
Name |
Hyalodendriol A
|
| Molecular Formula | C16H18O7 | |
| IUPAC Name* |
1,4,7-trihydroxy-3,9-dimethoxy-1-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one
|
|
| SMILES |
COc1cc(O)c2c(=O)oc3c(c2c1)C(C)(O)CC(OC)C3O
|
|
| InChI |
InChI=1S/C16H18O7/c1-16(20)6-10(22-3)13(18)14-12(16)8-4-7(21-2)5-9(17)11(8)15(19)23-14/h4-5,10,13,17-18,20H,6H2,1-3H3/t10-,13+,16+/m1/s1
|
|
| InChIKey |
WRXZEISOIUGTDU-HICWGWBUSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 322.31 | ALogp: | 1.2 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 109.4 | Aromatic Rings: | 3 |
| Heavy Atoms: | 23 | QED Weighted: | 0.771 |
| Caco-2 Permeability: | -5.11 | MDCK Permeability: | 0.00000803 |
| Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.376 |
| Human Intestinal Absorption (HIA): | 0.409 | 20% Bioavailability (F20%): | 0.014 |
| 30% Bioavailability (F30%): | 0.718 |
| Blood-Brain-Barrier Penetration (BBB): | 0.169 | Plasma Protein Binding (PPB): | 67.59% |
| Volume Distribution (VD): | 1.168 | Fu: | 23.21% |
| CYP1A2-inhibitor: | 0.113 | CYP1A2-substrate: | 0.9 |
| CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.787 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.625 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.291 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.191 |
| Clearance (CL): | 5.164 | Half-life (T1/2): | 0.47 |
| hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.807 |
| Drug-inuced Liver Injury (DILI): | 0.941 | AMES Toxicity: | 0.163 |
| Rat Oral Acute Toxicity: | 0.173 | Maximum Recommended Daily Dose: | 0.156 |
| Skin Sensitization: | 0.456 | Carcinogencity: | 0.021 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
| Respiratory Toxicity: | 0.147 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005094 | ![]() |
0.779 | D06GCK | ![]() |
0.272 | ||
| ENC003829 | ![]() |
0.615 | D0G4KG | ![]() |
0.264 | ||
| ENC003469 | ![]() |
0.605 | D07MGA | ![]() |
0.255 | ||
| ENC003464 | ![]() |
0.605 | D0D4HN | ![]() |
0.235 | ||
| ENC002938 | ![]() |
0.568 | D0C1SF | ![]() |
0.233 | ||
| ENC002959 | ![]() |
0.562 | D04UTT | ![]() |
0.228 | ||
| ENC003115 | ![]() |
0.531 | D0J4IX | ![]() |
0.228 | ||
| ENC002502 | ![]() |
0.518 | D04AIT | ![]() |
0.224 | ||
| ENC003470 | ![]() |
0.518 | D0H0SJ | ![]() |
0.224 | ||
| ENC003468 | ![]() |
0.500 | D0Q0PR | ![]() |
0.223 | ||