|
Name |
Rhizopycnolide A
|
| Molecular Formula | C19H20O9 | |
| IUPAC Name* |
(1S,3R,3'R,4S)-1,3',7-trihydroxy-3,9-dimethoxy-1-methylspiro[2,3-dihydrobenzo[c]chromene-4,5'-oxolane]-2',6-dione
|
|
| SMILES |
C[C@@]1(C[C@H]([C@@]2(C[C@H](C(=O)O2)O)C3=C1C4=C(C(=CC(=C4)OC)O)C(=O)O3)OC)O
|
|
| InChI |
InChI=1S/C19H20O9/c1-18(24)7-12(26-3)19(6-11(21)16(22)28-19)15-14(18)9-4-8(25-2)5-10(20)13(9)17(23)27-15/h4-5,11-12,20-21,24H,6-7H2,1-3H3/t11-,12-,18+,19+/m1/s1
|
|
| InChIKey |
DXDVGVFRBGQXNB-WPZAJUNFSA-N
|
|
| Synonyms |
Rhizopycnolide A; CHEMBL3889740; CHEBI:141316; (1S,3R,4S,4'R)-1,4',7-trihydroxy-3,9-dimethoxy-1-methyl-2,3,3',4'-tetrahydro-1H,5'H,6H-spiro[benzo[c]chromene-4,2'-furan]-5',6-dione
|
|
| CAS | NA | |
| PubChem CID | 134131607 | |
| ChEMBL ID | CHEMBL3889740 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 392.4 | ALogp: | 0.1 |
| HBD: | 3 | HBA: | 9 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 132.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 28 | QED Weighted: | 0.64 |
| Caco-2 Permeability: | -5.862 | MDCK Permeability: | 0.00000922 |
| Pgp-inhibitor: | 0.043 | Pgp-substrate: | 0.998 |
| Human Intestinal Absorption (HIA): | 0.222 | 20% Bioavailability (F20%): | 0.445 |
| 30% Bioavailability (F30%): | 0.855 |
| Blood-Brain-Barrier Penetration (BBB): | 0.169 | Plasma Protein Binding (PPB): | 63.64% |
| Volume Distribution (VD): | 1.291 | Fu: | 28.73% |
| CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.976 |
| CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.697 |
| CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.132 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.242 |
| CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.148 |
| Clearance (CL): | 6.064 | Half-life (T1/2): | 0.719 |
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.69 |
| Drug-inuced Liver Injury (DILI): | 0.926 | AMES Toxicity: | 0.345 |
| Rat Oral Acute Toxicity: | 0.892 | Maximum Recommended Daily Dose: | 0.829 |
| Skin Sensitization: | 0.606 | Carcinogencity: | 0.236 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.042 |
| Respiratory Toxicity: | 0.932 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003469 | ![]() |
1.000 | D0G4KG | ![]() |
0.252 | ||
| ENC005093 | ![]() |
0.605 | D06GCK | ![]() |
0.250 | ||
| ENC005094 | ![]() |
0.552 | D0C1SF | ![]() |
0.248 | ||
| ENC002938 | ![]() |
0.529 | D0D4HN | ![]() |
0.238 | ||
| ENC003829 | ![]() |
0.505 | D01XWG | ![]() |
0.234 | ||
| ENC003115 | ![]() |
0.500 | D07MGA | ![]() |
0.234 | ||
| ENC002502 | ![]() |
0.489 | D0H0SJ | ![]() |
0.234 | ||
| ENC003470 | ![]() |
0.489 | D0R6RC | ![]() |
0.227 | ||
| ENC003468 | ![]() |
0.473 | D0Q0PR | ![]() |
0.226 | ||
| ENC002959 | ![]() |
0.455 | D0C9XJ | ![]() |
0.221 | ||