NPs Basic Information
|
Name |
5-hydroxymellein
|
| Molecular Formula | C11H12O3 | |
| IUPAC Name* |
3-methyl-1-methylidene-3,4-dihydroisochromene-5,8-diol
|
|
| SMILES |
C=C1OC(C)Cc2c(O)ccc(O)c21
|
|
| InChI |
InChI=1S/C11H12O3/c1-6-5-8-9(12)3-4-10(13)11(8)7(2)14-6/h3-4,6,12-13H,2,5H2,1H3/t6-/m1/s1
|
|
| InChIKey |
GJHRPTQCBQFUHM-ZCFIWIBFSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 192.21 | ALogp: | 2.0 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 49.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.621 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.76 | MDCK Permeability: | 0.00002270 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.022 |
| 30% Bioavailability (F30%): | 0.027 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.171 | Plasma Protein Binding (PPB): | 94.56% |
| Volume Distribution (VD): | 0.727 | Fu: | 5.38% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.929 | CYP1A2-substrate: | 0.516 |
| CYP2C19-inhibitor: | 0.099 | CYP2C19-substrate: | 0.106 |
| CYP2C9-inhibitor: | 0.208 | CYP2C9-substrate: | 0.866 |
| CYP2D6-inhibitor: | 0.821 | CYP2D6-substrate: | 0.794 |
| CYP3A4-inhibitor: | 0.111 | CYP3A4-substrate: | 0.211 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 12.928 | Half-life (T1/2): | 0.702 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.166 |
| Drug-inuced Liver Injury (DILI): | 0.38 | AMES Toxicity: | 0.326 |
| Rat Oral Acute Toxicity: | 0.581 | Maximum Recommended Daily Dose: | 0.198 |
| Skin Sensitization: | 0.743 | Carcinogencity: | 0.864 |
| Eye Corrosion: | 0.177 | Eye Irritation: | 0.893 |
| Respiratory Toxicity: | 0.706 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005939 |  |
0.727 | D07MGA |  |
0.286 | ||
| ENC005026 |  |
0.560 | D0H6QU |  |
0.267 | ||
| ENC002309 |  |
0.520 | D0T7OW |  |
0.259 | ||
| ENC003320 |  |
0.519 | D04PHC |  |
0.259 | ||
| ENC002310 |  |
0.519 | D02NSF |  |
0.250 | ||
| ENC004808 |  |
0.500 | D07MOX |  |
0.250 | ||
| ENC005940 |  |
0.500 | D0BA6T |  |
0.242 | ||
| ENC005941 |  |
0.448 | D04JHN |  |
0.241 | ||
| ENC002045 |  |
0.444 | D0WE3O |  |
0.241 | ||
| ENC005535 |  |
0.444 | D05VIL |  |
0.239 | ||