![]() |
Name |
3β-hydroxy-sterol
|
Molecular Formula | C28H50O | |
IUPAC Name* |
6-(5,6-dimethylhept-3-en-2-yl)-1,5-dimethyltricyclo[11.4.0.05,9]heptadecan-15-ol
|
|
SMILES |
CC(C)C(C)C=CC(C)C1CCC2CCCC3CC(O)CCC3(C)CCCC21C
|
|
InChI |
InChI=1S/C28H50O/c1-20(2)21(3)11-12-22(4)26-14-13-23-9-7-10-24-19-25(29)15-18-27(24,5)16-8-17-28(23,26)6/h11-12,20-26,29H,7-10,13-19H2,1-6H3/b12-11+/t21-,22+,23?,24?,25-,26?,27-,28-/m0/s1
|
|
InChIKey |
BVGNXQCZHIJBSG-RMQCZREVSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.71 | ALogp: | 8.0 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 20.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.451 |
Caco-2 Permeability: | -4.709 | MDCK Permeability: | 0.00000698 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.025 |
30% Bioavailability (F30%): | 0.787 |
Blood-Brain-Barrier Penetration (BBB): | 0.548 | Plasma Protein Binding (PPB): | 99.04% |
Volume Distribution (VD): | 1.804 | Fu: | 1.63% |
CYP1A2-inhibitor: | 0.047 | CYP1A2-substrate: | 0.615 |
CYP2C19-inhibitor: | 0.073 | CYP2C19-substrate: | 0.954 |
CYP2C9-inhibitor: | 0.099 | CYP2C9-substrate: | 0.219 |
CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.574 |
CYP3A4-inhibitor: | 0.465 | CYP3A4-substrate: | 0.769 |
Clearance (CL): | 15.016 | Half-life (T1/2): | 0.02 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.004 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.032 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.118 |
Skin Sensitization: | 0.285 | Carcinogencity: | 0.013 |
Eye Corrosion: | 0.039 | Eye Irritation: | 0.243 |
Respiratory Toxicity: | 0.057 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004735 | ![]() |
0.584 | D0G8OC | ![]() |
0.495 | ||
ENC004739 | ![]() |
0.538 | D06JPB | ![]() |
0.455 | ||
ENC004758 | ![]() |
0.524 | D0G5CF | ![]() |
0.446 | ||
ENC001558 | ![]() |
0.524 | D0N1TP | ![]() |
0.361 | ||
ENC005707 | ![]() |
0.509 | D0Y7LD | ![]() |
0.347 | ||
ENC001092 | ![]() |
0.509 | D01QUS | ![]() |
0.347 | ||
ENC004738 | ![]() |
0.509 | D00VZZ | ![]() |
0.346 | ||
ENC006034 | ![]() |
0.495 | D03ZTE | ![]() |
0.319 | ||
ENC003121 | ![]() |
0.495 | D0G3SH | ![]() |
0.319 | ||
ENC001984 | ![]() |
0.491 | D08SVH | ![]() |
0.306 |