![]() |
Name |
(±)-trichodermatrione A
|
Molecular Formula | C14H14O4 | |
IUPAC Name* |
3-hydroxy-4,7-dimethyltricyclo[6.4.0.01,6]dodeca-3,9-diene-2,5,11-trione
|
|
SMILES |
CC1=C(O)C(=O)C23CC(=O)C=CC2C(C)C3C1=O
|
|
InChI |
InChI=1S/C14H14O4/c1-6-9-4-3-8(15)5-14(9)10(6)11(16)7(2)12(17)13(14)18/h3-4,6,9-10,17H,5H2,1-2H3/t6-,9+,10-,14-/m0/s1
|
|
InChIKey |
VSQJKJLMLQOBMS-SLXTUHGTSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 246.26 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.708 |
Caco-2 Permeability: | -4.664 | MDCK Permeability: | 0.00009880 |
Pgp-inhibitor: | 0.336 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.768 | Plasma Protein Binding (PPB): | 72.97% |
Volume Distribution (VD): | 0.357 | Fu: | 32.27% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.843 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.745 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.078 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.128 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.469 |
Clearance (CL): | 7.662 | Half-life (T1/2): | 0.291 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.084 |
Drug-inuced Liver Injury (DILI): | 0.633 | AMES Toxicity: | 0.023 |
Rat Oral Acute Toxicity: | 0.805 | Maximum Recommended Daily Dose: | 0.846 |
Skin Sensitization: | 0.476 | Carcinogencity: | 0.823 |
Eye Corrosion: | 0.038 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004596 | ![]() |
1.000 | D0K7LU | ![]() |
0.276 | ||
ENC004597 | ![]() |
0.778 | D08NQZ | ![]() |
0.222 | ||
ENC000788 | ![]() |
0.305 | D0R9WP | ![]() |
0.222 | ||
ENC001006 | ![]() |
0.276 | D0S0LZ | ![]() |
0.222 | ||
ENC004782 | ![]() |
0.276 | D0I5DS | ![]() |
0.222 | ||
ENC002293 | ![]() |
0.274 | D0R6RC | ![]() |
0.218 | ||
ENC001362 | ![]() |
0.258 | D0J2NK | ![]() |
0.218 | ||
ENC002338 | ![]() |
0.257 | D08LTU | ![]() |
0.216 | ||
ENC002805 | ![]() |
0.250 | D0IL7L | ![]() |
0.214 | ||
ENC004778 | ![]() |
0.250 | D0H1AR | ![]() |
0.211 |