![]() |
Name |
xylaripyone E
|
Molecular Formula | C13H16O7 | |
IUPAC Name* |
methyl4-methoxy-2-(4-methoxy-4-oxobutyl)-6-oxopyran-3-carboxylate
|
|
SMILES |
COC(=O)CCCc1oc(=O)cc(OC)c1C(=O)OC
|
|
InChI |
InChI=1S/C13H16O7/c1-17-9-7-11(15)20-8(12(9)13(16)19-3)5-4-6-10(14)18-2/h7H,4-6H2,1-3H3
|
|
InChIKey |
XQKUNCKTBIILRI-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.26 | ALogp: | 0.9 |
HBD: | 0 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.728 |
Caco-2 Permeability: | -4.596 | MDCK Permeability: | 0.00009910 |
Pgp-inhibitor: | 0.019 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.041 |
30% Bioavailability (F30%): | 0.986 |
Blood-Brain-Barrier Penetration (BBB): | 0.942 | Plasma Protein Binding (PPB): | 43.12% |
Volume Distribution (VD): | 0.772 | Fu: | 42.04% |
CYP1A2-inhibitor: | 0.947 | CYP1A2-substrate: | 0.944 |
CYP2C19-inhibitor: | 0.627 | CYP2C19-substrate: | 0.196 |
CYP2C9-inhibitor: | 0.191 | CYP2C9-substrate: | 0.743 |
CYP2D6-inhibitor: | 0.042 | CYP2D6-substrate: | 0.477 |
CYP3A4-inhibitor: | 0.103 | CYP3A4-substrate: | 0.227 |
Clearance (CL): | 9.761 | Half-life (T1/2): | 0.889 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.827 |
Drug-inuced Liver Injury (DILI): | 0.926 | AMES Toxicity: | 0.03 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.138 |
Skin Sensitization: | 0.166 | Carcinogencity: | 0.024 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.156 |
Respiratory Toxicity: | 0.071 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004527 | ![]() |
0.914 | D0OL6O | ![]() |
0.270 | ||
ENC004525 | ![]() |
0.875 | D09ELP | ![]() |
0.250 | ||
ENC004523 | ![]() |
0.780 | D0T5OX | ![]() |
0.240 | ||
ENC004524 | ![]() |
0.714 | D06TQZ | ![]() |
0.240 | ||
ENC004528 | ![]() |
0.708 | D0G6VL | ![]() |
0.237 | ||
ENC004522 | ![]() |
0.700 | D0I5HV | ![]() |
0.235 | ||
ENC005633 | ![]() |
0.522 | D04OSE | ![]() |
0.235 | ||
ENC005636 | ![]() |
0.493 | D03XTC | ![]() |
0.231 | ||
ENC005277 | ![]() |
0.474 | D02DKD | ![]() |
0.229 | ||
ENC005635 | ![]() |
0.452 | D02LCR | ![]() |
0.228 |