|
Name |
xylaripyone D
|
| Molecular Formula | C12H14O7 | |
| IUPAC Name* |
methyl4-methoxy-2-(3-methoxy-3-oxopropyl)-6-oxopyran-3-carboxylate
|
|
| SMILES |
COC(=O)CCc1oc(=O)cc(OC)c1C(=O)OC
|
|
| InChI |
InChI=1S/C12H14O7/c1-16-8-6-10(14)19-7(4-5-9(13)17-2)11(8)12(15)18-3/h6H,4-5H2,1-3H3
|
|
| InChIKey |
HYCIGYIISIXWHK-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 270.24 | ALogp: | 0.5 |
| HBD: | 0 | HBA: | 7 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 92.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 19 | QED Weighted: | 0.735 |
| Caco-2 Permeability: | -4.58 | MDCK Permeability: | 0.00009940 |
| Pgp-inhibitor: | 0.013 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.059 |
| 30% Bioavailability (F30%): | 0.99 |
| Blood-Brain-Barrier Penetration (BBB): | 0.949 | Plasma Protein Binding (PPB): | 36.76% |
| Volume Distribution (VD): | 0.821 | Fu: | 46.10% |
| CYP1A2-inhibitor: | 0.887 | CYP1A2-substrate: | 0.948 |
| CYP2C19-inhibitor: | 0.368 | CYP2C19-substrate: | 0.176 |
| CYP2C9-inhibitor: | 0.076 | CYP2C9-substrate: | 0.702 |
| CYP2D6-inhibitor: | 0.028 | CYP2D6-substrate: | 0.409 |
| CYP3A4-inhibitor: | 0.053 | CYP3A4-substrate: | 0.25 |
| Clearance (CL): | 9.8 | Half-life (T1/2): | 0.893 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.846 |
| Drug-inuced Liver Injury (DILI): | 0.937 | AMES Toxicity: | 0.04 |
| Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.14 |
| Skin Sensitization: | 0.168 | Carcinogencity: | 0.024 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.212 |
| Respiratory Toxicity: | 0.068 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004526 | ![]() |
0.875 | D0OL6O | ![]() |
0.262 | ||
| ENC004527 | ![]() |
0.831 | D06TQZ | ![]() |
0.247 | ||
| ENC004522 | ![]() |
0.768 | D09ELP | ![]() |
0.245 | ||
| ENC004523 | ![]() |
0.700 | D0I5HV | ![]() |
0.244 | ||
| ENC004524 | ![]() |
0.667 | D04OSE | ![]() |
0.242 | ||
| ENC004528 | ![]() |
0.662 | D03XTC | ![]() |
0.239 | ||
| ENC005633 | ![]() |
0.478 | D02DKD | ![]() |
0.236 | ||
| ENC005954 | ![]() |
0.468 | D0T5OX | ![]() |
0.235 | ||
| ENC003263 | ![]() |
0.444 | D0A1DH | ![]() |
0.235 | ||
| ENC005956 | ![]() |
0.433 | D02XJY | ![]() |
0.235 | ||