![]() |
Name |
Epicoccane D
|
Molecular Formula | C16H18O7 | |
IUPAC Name* |
3,7,15-trihydroxy-5,8,14-trimethyl-6,11-dioxatetracyclo[7.3.3.01,9.03,7]pentadeca-4,14-diene-2,13-dione
|
|
SMILES |
CC1=CC2(O)C(=O)C34COCC3(C(=O)C(O)=C4C)C(C)C2(O)O1
|
|
InChI |
InChI=1S/C16H18O7/c1-7-4-15(20)12(19)13-5-22-6-14(13,9(3)16(15,21)23-7)11(18)10(17)8(13)2/h4,9,17,20-21H,5-6H2,1-3H3/t9-,13-,14-,15-,16-/m1/s1
|
|
InChIKey |
TYMIMEQLZRBVJG-SQSOSVTJSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 322.31 | ALogp: | 0.0 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 23 | QED Weighted: | 0.591 |
Caco-2 Permeability: | -5.288 | MDCK Permeability: | 0.00001800 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.061 | 20% Bioavailability (F20%): | 0.644 |
30% Bioavailability (F30%): | 0.02 |
Blood-Brain-Barrier Penetration (BBB): | 0.976 | Plasma Protein Binding (PPB): | 56.83% |
Volume Distribution (VD): | 0.999 | Fu: | 51.01% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.982 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.816 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.036 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.081 |
CYP3A4-inhibitor: | 0.02 | CYP3A4-substrate: | 0.909 |
Clearance (CL): | 2.667 | Half-life (T1/2): | 0.152 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.214 |
Drug-inuced Liver Injury (DILI): | 0.5 | AMES Toxicity: | 0.753 |
Rat Oral Acute Toxicity: | 0.924 | Maximum Recommended Daily Dose: | 0.773 |
Skin Sensitization: | 0.087 | Carcinogencity: | 0.235 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.024 |
Respiratory Toxicity: | 0.96 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002893 | ![]() |
0.391 | D0G6AB | ![]() |
0.230 | ||
ENC005915 | ![]() |
0.368 | D0K7LU | ![]() |
0.209 | ||
ENC004486 | ![]() |
0.315 | D08NQZ | ![]() |
0.208 | ||
ENC004484 | ![]() |
0.299 | D0R6RC | ![]() |
0.205 | ||
ENC004748 | ![]() |
0.288 | D0C8HR | ![]() |
0.197 | ||
ENC005059 | ![]() |
0.281 | D02GAC | ![]() |
0.195 | ||
ENC001409 | ![]() |
0.275 | D0J2NK | ![]() |
0.195 | ||
ENC004485 | ![]() |
0.272 | D02NSF | ![]() |
0.194 | ||
ENC004534 | ![]() |
0.269 | D08LTU | ![]() |
0.194 | ||
ENC002731 | ![]() |
0.267 | D0C1SF | ![]() |
0.189 |