|
Name |
(1S,4R,8R,9S,11E,13R,14S,17R,18S)-6,14-dihydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatetracyclo[11.7.0.01,17.04,8]icosa-6,11,15-triene-2,5,20-trione
|
| Molecular Formula | C32H36N2O5 | |
| IUPAC Name* |
(1S,4R,8R,9S,11E,13R,14S,17R,18S)-6,14-dihydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatetracyclo[11.7.0.01,17.04,8]icosa-6,11,15-triene-2,5,20-trione
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C([C@@H]3[C@]2(C(=O)C[C@@H]4[C@@H]1C(=C(C4=O)O)C)C(=O)N[C@H]3CC5=CNC6=CC=CC=C65)C)C)O
|
|
| InChI |
InChI=1S/C32H36N2O5/c1-15-8-7-10-22-28(36)17(3)16(2)27-24(12-19-14-33-23-11-6-5-9-20(19)23)34-31(39)32(22,27)25(35)13-21-26(15)18(4)29(37)30(21)38/h5-7,9-11,14-15,21-22,24,26-28,33,36-37H,8,12-13H2,1-4H3,(H,34,39)/b10-7+/t15-,21+,22-,24-,26-,27-,28+,32-/m0/s1
|
|
| InChIKey |
PRTGSLLKDHOTJT-WJWUOCSESA-N
|
|
| Synonyms |
chaetoglobosin Vb; DTXSID701316528; 1399690-75-5
|
|
| CAS | 1399690-75-5 | |
| PubChem CID | 165359453 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 528.6 | ALogp: | 2.5 |
| HBD: | 4 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 120.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 39 | QED Weighted: | 0.327 |
| Caco-2 Permeability: | -5.18 | MDCK Permeability: | 0.00000598 |
| Pgp-inhibitor: | 0.879 | Pgp-substrate: | 0.998 |
| Human Intestinal Absorption (HIA): | 0.046 | 20% Bioavailability (F20%): | 0.014 |
| 30% Bioavailability (F30%): | 0.013 |
| Blood-Brain-Barrier Penetration (BBB): | 0.235 | Plasma Protein Binding (PPB): | 98.33% |
| Volume Distribution (VD): | 0.476 | Fu: | 2.42% |
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.637 |
| CYP2C19-inhibitor: | 0.714 | CYP2C19-substrate: | 0.748 |
| CYP2C9-inhibitor: | 0.48 | CYP2C9-substrate: | 0.238 |
| CYP2D6-inhibitor: | 0.092 | CYP2D6-substrate: | 0.235 |
| CYP3A4-inhibitor: | 0.942 | CYP3A4-substrate: | 0.638 |
| Clearance (CL): | 10.204 | Half-life (T1/2): | 0.082 |
| hERG Blockers: | 0.067 | Human Hepatotoxicity (H-HT): | 0.252 |
| Drug-inuced Liver Injury (DILI): | 0.16 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.83 | Maximum Recommended Daily Dose: | 0.934 |
| Skin Sensitization: | 0.182 | Carcinogencity: | 0.036 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.968 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002678 | ![]() |
0.785 | D0W7WC | ![]() |
0.265 | ||
| ENC002166 | ![]() |
0.722 | D0SP3D | ![]() |
0.249 | ||
| ENC002443 | ![]() |
0.714 | D09NNH | ![]() |
0.249 | ||
| ENC002441 | ![]() |
0.688 | D0V3ZA | ![]() |
0.249 | ||
| ENC003226 | ![]() |
0.662 | D01TSI | ![]() |
0.242 | ||
| ENC002955 | ![]() |
0.636 | D01XDL | ![]() |
0.241 | ||
| ENC004447 | ![]() |
0.565 | D02DMQ | ![]() |
0.240 | ||
| ENC002681 | ![]() |
0.554 | D05EJG | ![]() |
0.240 | ||
| ENC002442 | ![]() |
0.543 | D0S0LZ | ![]() |
0.239 | ||
| ENC002440 | ![]() |
0.532 | D05MQK | ![]() |
0.239 | ||