|
Name |
Chaetoglobosin G
|
| Molecular Formula | C32H36N2O5 | |
| IUPAC Name* |
(1R,7E,9S,11E,13R,14S,17R,18S)-14-hydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatricyclo[11.7.0.01,17]icosa-7,11,15-triene-2,5,6,20-tetrone
|
|
| SMILES |
C[C@H]\1C/C=C/[C@H]2[C@@H](C(=C([C@@H]3[C@@]2(C(=O)CCC(=O)C(=O)/C(=C1)/C)C(=O)N[C@H]3CC4=CNC5=CC=CC=C54)C)C)O
|
|
| InChI |
InChI=1S/C32H36N2O5/c1-17-8-7-10-23-30(38)20(4)19(3)28-25(15-21-16-33-24-11-6-5-9-22(21)24)34-31(39)32(23,28)27(36)13-12-26(35)29(37)18(2)14-17/h5-7,9-11,14,16-17,23,25,28,30,33,38H,8,12-13,15H2,1-4H3,(H,34,39)/b10-7+,18-14+/t17-,23-,25-,28-,30+,32+/m0/s1
|
|
| InChIKey |
COZBDBUQXIMMKP-RWFPWACCSA-N
|
|
| Synonyms |
Chaetoglobosin G; CHEBI:68813; Cheatoglobosin G; 65773-98-0; SCHEMBL33632; CHEMBL486257; Q27137191; (1R,7E,9S,11E,13R,14S,17R,18S)-14-hydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatricyclo[11.7.0.01,17]icosa-7,11,15-triene-2,5,6,20-tetrone; (3S,3aR,6S,6aR,7E,10S,11E,17aR)-6-hydroxy-3-(1H-indol-3-ylmethyl)-4,5,10,12-tetramethyl-3,3a,6,6a,9,10,15,16-octahydro-1H-cyclotrideca[d]isoindole-1,13,14,17(2H)-tetrone
|
|
| CAS | NA | |
| PubChem CID | 23259924 | |
| ChEMBL ID | CHEMBL486257 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 528.6 | ALogp: | 2.6 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 116.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 39 | QED Weighted: | 0.295 |
| Caco-2 Permeability: | -4.995 | MDCK Permeability: | 0.00001110 |
| Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.991 |
| Human Intestinal Absorption (HIA): | 0.034 | 20% Bioavailability (F20%): | 0.025 |
| 30% Bioavailability (F30%): | 0.023 |
| Blood-Brain-Barrier Penetration (BBB): | 0.044 | Plasma Protein Binding (PPB): | 98.53% |
| Volume Distribution (VD): | 0.737 | Fu: | 2.94% |
| CYP1A2-inhibitor: | 0.077 | CYP1A2-substrate: | 0.434 |
| CYP2C19-inhibitor: | 0.887 | CYP2C19-substrate: | 0.761 |
| CYP2C9-inhibitor: | 0.869 | CYP2C9-substrate: | 0.832 |
| CYP2D6-inhibitor: | 0.204 | CYP2D6-substrate: | 0.199 |
| CYP3A4-inhibitor: | 0.95 | CYP3A4-substrate: | 0.321 |
| Clearance (CL): | 6.285 | Half-life (T1/2): | 0.177 |
| hERG Blockers: | 0.24 | Human Hepatotoxicity (H-HT): | 0.338 |
| Drug-inuced Liver Injury (DILI): | 0.218 | AMES Toxicity: | 0.452 |
| Rat Oral Acute Toxicity: | 0.699 | Maximum Recommended Daily Dose: | 0.959 |
| Skin Sensitization: | 0.863 | Carcinogencity: | 0.051 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.934 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002443 | ![]() |
0.815 | D09ZIO | ![]() |
0.259 | ||
| ENC002442 | ![]() |
0.785 | D0W7WC | ![]() |
0.257 | ||
| ENC004465 | ![]() |
0.722 | D02DMQ | ![]() |
0.257 | ||
| ENC002680 | ![]() |
0.709 | D01TSI | ![]() |
0.255 | ||
| ENC003226 | ![]() |
0.701 | D0SP3D | ![]() |
0.249 | ||
| ENC004469 | ![]() |
0.688 | D09NNH | ![]() |
0.249 | ||
| ENC002955 | ![]() |
0.662 | D0V3ZA | ![]() |
0.249 | ||
| ENC002681 | ![]() |
0.636 | D01XDL | ![]() |
0.241 | ||
| ENC004447 | ![]() |
0.636 | D05EJG | ![]() |
0.240 | ||
| ENC003245 | ![]() |
0.621 | D05MQK | ![]() |
0.239 | ||