|
Name |
(3S,6S)-3-[(R)-hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione
|
| Molecular Formula | C19H23N3O3 | |
| IUPAC Name* |
(3S,6S)-3-[(R)-hydroxy-[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-6-methylpiperazine-2,5-dione
|
|
| SMILES |
C[C@H]1C(=O)N[C@H](C(=O)N1)[C@@H](C2=C(NC3=CC=CC=C32)C(C)(C)C=C)O
|
|
| InChI |
InChI=1S/C19H23N3O3/c1-5-19(3,4)16-13(11-8-6-7-9-12(11)21-16)15(23)14-18(25)20-10(2)17(24)22-14/h5-10,14-15,21,23H,1H2,2-4H3,(H,20,25)(H,22,24)/t10-,14-,15+/m0/s1
|
|
| InChIKey |
WWTLLWSFFUIRKA-NZVBXONLSA-N
|
|
| Synonyms |
Rubrumline M
|
|
| CAS | NA | |
| PubChem CID | 156583107 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 341.4 | ALogp: | 2.6 |
| HBD: | 4 | HBA: | 3 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 94.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 25 | QED Weighted: | 0.643 |
| Caco-2 Permeability: | -5.405 | MDCK Permeability: | 0.00001310 |
| Pgp-inhibitor: | 0.53 | Pgp-substrate: | 0.189 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.02 |
| Blood-Brain-Barrier Penetration (BBB): | 0.645 | Plasma Protein Binding (PPB): | 80.97% |
| Volume Distribution (VD): | 1.394 | Fu: | 23.66% |
| CYP1A2-inhibitor: | 0.31 | CYP1A2-substrate: | 0.212 |
| CYP2C19-inhibitor: | 0.175 | CYP2C19-substrate: | 0.097 |
| CYP2C9-inhibitor: | 0.103 | CYP2C9-substrate: | 0.339 |
| CYP2D6-inhibitor: | 0.225 | CYP2D6-substrate: | 0.48 |
| CYP3A4-inhibitor: | 0.721 | CYP3A4-substrate: | 0.259 |
| Clearance (CL): | 1.751 | Half-life (T1/2): | 0.294 |
| hERG Blockers: | 0.058 | Human Hepatotoxicity (H-HT): | 0.14 |
| Drug-inuced Liver Injury (DILI): | 0.379 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.773 | Maximum Recommended Daily Dose: | 0.684 |
| Skin Sensitization: | 0.05 | Carcinogencity: | 0.058 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.974 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002631 | ![]() |
0.696 | D0W7WC | ![]() |
0.270 | ||
| ENC004929 | ![]() |
0.663 | D01PZD | ![]() |
0.253 | ||
| ENC005569 | ![]() |
0.595 | D05MQK | ![]() |
0.246 | ||
| ENC001957 | ![]() |
0.595 | D0H5MB | ![]() |
0.246 | ||
| ENC004930 | ![]() |
0.570 | D0U7GP | ![]() |
0.243 | ||
| ENC003796 | ![]() |
0.528 | D01JGV | ![]() |
0.243 | ||
| ENC002895 | ![]() |
0.522 | D03GET | ![]() |
0.238 | ||
| ENC002717 | ![]() |
0.495 | D05EJG | ![]() |
0.236 | ||
| ENC004926 | ![]() |
0.490 | D05EPM | ![]() |
0.236 | ||
| ENC002068 | ![]() |
0.485 | D0U7GK | ![]() |
0.235 | ||