![]() |
Name |
Aplojaveediin C
|
Molecular Formula | C13H18O5 | |
IUPAC Name* |
4-[(4S)-4,5-dihydroxypentyl]-2,6-dihydroxy-3-methylbenzaldehyde
|
|
SMILES |
CC1=C(C(=C(C=C1CCC[C@@H](CO)O)O)C=O)O
|
|
InChI |
InChI=1S/C13H18O5/c1-8-9(3-2-4-10(16)6-14)5-12(17)11(7-15)13(8)18/h5,7,10,14,16-18H,2-4,6H2,1H3/t10-/m0/s1
|
|
InChIKey |
BGRFUFSSPJCPCK-JTQLQIEISA-N
|
|
Synonyms |
Aplojaveediin C
|
|
CAS | NA | |
PubChem CID | 156582741 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.28 | ALogp: | 1.3 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 98.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.574 |
Caco-2 Permeability: | -4.912 | MDCK Permeability: | 0.00000387 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.835 |
Human Intestinal Absorption (HIA): | 0.179 | 20% Bioavailability (F20%): | 0.978 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.264 | Plasma Protein Binding (PPB): | 83.90% |
Volume Distribution (VD): | 0.685 | Fu: | 13.69% |
CYP1A2-inhibitor: | 0.282 | CYP1A2-substrate: | 0.099 |
CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.173 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.422 |
CYP2D6-inhibitor: | 0.022 | CYP2D6-substrate: | 0.225 |
CYP3A4-inhibitor: | 0.032 | CYP3A4-substrate: | 0.093 |
Clearance (CL): | 12.735 | Half-life (T1/2): | 0.904 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.275 |
Rat Oral Acute Toxicity: | 0.007 | Maximum Recommended Daily Dose: | 0.485 |
Skin Sensitization: | 0.859 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.27 | Eye Irritation: | 0.891 |
Respiratory Toxicity: | 0.829 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004247 | ![]() |
0.679 | D06JGH | ![]() |
0.286 | ||
ENC004248 | ![]() |
0.655 | D07MUN | ![]() |
0.246 | ||
ENC004250 | ![]() |
0.627 | D06KYN | ![]() |
0.242 | ||
ENC004249 | ![]() |
0.579 | D0J7RK | ![]() |
0.236 | ||
ENC004428 | ![]() |
0.571 | D07AHW | ![]() |
0.234 | ||
ENC001359 | ![]() |
0.411 | D0K5CB | ![]() |
0.224 | ||
ENC004668 | ![]() |
0.410 | D02ZJI | ![]() |
0.224 | ||
ENC004977 | ![]() |
0.373 | D0YH0N | ![]() |
0.224 | ||
ENC005282 | ![]() |
0.353 | D04PHC | ![]() |
0.221 | ||
ENC002292 | ![]() |
0.350 | D0O1UZ | ![]() |
0.220 |