|
Name |
penochalasin K
|
| Molecular Formula | C32H34N2O4 | |
| IUPAC Name* |
(1S,7E,9S,11E,13S,16S,27S,30R)-7,9,15,16-tetramethyl-18,28-diazahexacyclo[14.13.1.01,13.017,25.019,24.027,30]triaconta-7,11,14,17(25),19,21,23-heptaene-2,5,6,29-tetrone
|
|
| SMILES |
C[C@H]\1C/C=C/[C@H]2C=C([C@@]3([C@@H]4[C@@]2(C(=O)CCC(=O)C(=O)/C(=C1)/C)C(=O)N[C@H]4CC5=C3NC6=CC=CC=C56)C)C
|
|
| InChI |
InChI=1S/C32H34N2O4/c1-17-8-7-9-20-15-19(3)31(4)28-24(16-22-21-10-5-6-11-23(21)33-29(22)31)34-30(38)32(20,28)26(36)13-12-25(35)27(37)18(2)14-17/h5-7,9-11,14-15,17,20,24,28,33H,8,12-13,16H2,1-4H3,(H,34,38)/b9-7+,18-14+/t17-,20-,24-,28+,31+,32+/m0/s1
|
|
| InChIKey |
CZYPLDPCWJLDNG-SMCSONOWSA-N
|
|
| Synonyms |
penochalasin K
|
|
| CAS | NA | |
| PubChem CID | 156581489 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 510.6 | ALogp: | 4.1 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 96.1 | Aromatic Rings: | 6 |
| Heavy Atoms: | 38 | QED Weighted: | 0.292 |
| Caco-2 Permeability: | -4.976 | MDCK Permeability: | 0.00002740 |
| Pgp-inhibitor: | 0.969 | Pgp-substrate: | 0.975 |
| Human Intestinal Absorption (HIA): | 0.054 | 20% Bioavailability (F20%): | 0.165 |
| 30% Bioavailability (F30%): | 0.007 |
| Blood-Brain-Barrier Penetration (BBB): | 0.922 | Plasma Protein Binding (PPB): | 97.29% |
| Volume Distribution (VD): | 0.311 | Fu: | 1.24% |
| CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.73 |
| CYP2C19-inhibitor: | 0.836 | CYP2C19-substrate: | 0.705 |
| CYP2C9-inhibitor: | 0.842 | CYP2C9-substrate: | 0.798 |
| CYP2D6-inhibitor: | 0.552 | CYP2D6-substrate: | 0.22 |
| CYP3A4-inhibitor: | 0.957 | CYP3A4-substrate: | 0.596 |
| Clearance (CL): | 8.057 | Half-life (T1/2): | 0.078 |
| hERG Blockers: | 0.082 | Human Hepatotoxicity (H-HT): | 0.192 |
| Drug-inuced Liver Injury (DILI): | 0.134 | AMES Toxicity: | 0.472 |
| Rat Oral Acute Toxicity: | 0.94 | Maximum Recommended Daily Dose: | 0.964 |
| Skin Sensitization: | 0.874 | Carcinogencity: | 0.892 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.987 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002680 | ![]() |
0.581 | D05MQK | ![]() |
0.284 | ||
| ENC002441 | ![]() |
0.574 | D01JGV | ![]() |
0.266 | ||
| ENC004465 | ![]() |
0.558 | D0U7GP | ![]() |
0.266 | ||
| ENC002442 | ![]() |
0.540 | D01HTL | ![]() |
0.249 | ||
| ENC003856 | ![]() |
0.511 | D01TSI | ![]() |
0.245 | ||
| ENC003245 | ![]() |
0.493 | D04RLY | ![]() |
0.244 | ||
| ENC003855 | ![]() |
0.483 | D08VRO | ![]() |
0.243 | ||
| ENC002443 | ![]() |
0.456 | D09HDR | ![]() |
0.243 | ||
| ENC003586 | ![]() |
0.443 | D09QVV | ![]() |
0.240 | ||
| ENC004470 | ![]() |
0.443 | D0W9MM | ![]() |
0.237 | ||