NPs Basic Information
|
Name |
Solitumine B
|
| Molecular Formula | C20H25N3O4 | |
| IUPAC Name* |
(2S)-2-amino-5-[[2-(2-methylbut-3-en-2-yl)-4-oxo-1H-quinolin-3-yl]methylamino]-5-oxopentanoic acid
|
|
| SMILES |
CC(C)(C=C)C1=C(C(=O)C2=CC=CC=C2N1)CNC(=O)CC[C@@H](C(=O)O)N
|
|
| InChI |
InChI=1S/C20H25N3O4/c1-4-20(2,3)18-13(11-22-16(24)10-9-14(21)19(26)27)17(25)12-7-5-6-8-15(12)23-18/h4-8,14H,1,9-11,21H2,2-3H3,(H,22,24)(H,23,25)(H,26,27)/t14-/m0/s1
|
|
| InChIKey |
FUQBTAHOMZQIEP-AWEZNQCLSA-N
|
|
| Synonyms |
Solitumine B; CHEMBL4534871
|
|
| CAS | NA | |
| PubChem CID | 155549251 | |
| ChEMBL ID | CHEMBL4534871 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 371.4 | ALogp: | -0.1 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 122.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 27 | QED Weighted: | 0.53 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.34 | MDCK Permeability: | 0.00001910 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.04 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.002 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.143 | Plasma Protein Binding (PPB): | 65.26% |
| Volume Distribution (VD): | 0.568 | Fu: | 53.11% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.046 | CYP1A2-substrate: | 0.082 |
| CYP2C19-inhibitor: | 0.095 | CYP2C19-substrate: | 0.058 |
| CYP2C9-inhibitor: | 0.063 | CYP2C9-substrate: | 0.421 |
| CYP2D6-inhibitor: | 0.046 | CYP2D6-substrate: | 0.35 |
| CYP3A4-inhibitor: | 0.061 | CYP3A4-substrate: | 0.064 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 2.569 | Half-life (T1/2): | 0.654 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.127 |
| Drug-inuced Liver Injury (DILI): | 0.029 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.516 | Maximum Recommended Daily Dose: | 0.023 |
| Skin Sensitization: | 0.172 | Carcinogencity: | 0.024 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.944 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004232 |  |
0.778 | D05EJG |  |
0.353 | ||
| ENC004234 |  |
0.655 | D0E3SH |  |
0.298 | ||
| ENC004235 |  |
0.537 | D0W7WC |  |
0.291 | ||
| ENC004236 |  |
0.537 | D0BV3J |  |
0.284 | ||
| ENC004239 |  |
0.480 | D00DZN |  |
0.279 | ||
| ENC004927 |  |
0.456 | D0H5MB |  |
0.277 | ||
| ENC002214 |  |
0.444 | D0R1CR |  |
0.277 | ||
| ENC002899 |  |
0.444 | D0RA5Q |  |
0.269 | ||
| ENC002631 |  |
0.433 | D01KKQ |  |
0.268 | ||
| ENC004439 |  |
0.410 | D0Z5EM |  |
0.264 | ||