NPs Basic Information
|
Name |
(-)-asperglactam A
|
| Molecular Formula | C18H19NO6 | |
| IUPAC Name* |
(3S)-3-(2,6-dimethoxyphenyl)-4-hydroxy-6-(hydroxymethyl)-7-methoxy-2,3-dihydroisoindol-1-one
|
|
| SMILES |
COC1=C(C(=CC=C1)OC)[C@@H]2C3=C(C=C(C(=C3C(=O)N2)OC)CO)O
|
|
| InChI |
InChI=1S/C18H19NO6/c1-23-11-5-4-6-12(24-2)14(11)16-13-10(21)7-9(8-20)17(25-3)15(13)18(22)19-16/h4-7,16,20-21H,8H2,1-3H3,(H,19,22)/t16-/m0/s1
|
|
| InChIKey |
JCWCDHZHGMHDQR-INIZCTEOSA-N
|
|
| Synonyms |
(-)-asperglactam A
|
|
| CAS | NA | |
| PubChem CID | 146684271 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 345.3 | ALogp: | 1.1 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 97.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 25 | QED Weighted: | 0.77 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.041 | MDCK Permeability: | 0.00000941 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.601 |
| Human Intestinal Absorption (HIA): | 0.064 | 20% Bioavailability (F20%): | 0.012 |
| 30% Bioavailability (F30%): | 0.014 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.759 | Plasma Protein Binding (PPB): | 63.20% |
| Volume Distribution (VD): | 0.896 | Fu: | 24.72% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.555 |
| CYP2C19-inhibitor: | 0.119 | CYP2C19-substrate: | 0.893 |
| CYP2C9-inhibitor: | 0.406 | CYP2C9-substrate: | 0.835 |
| CYP2D6-inhibitor: | 0.027 | CYP2D6-substrate: | 0.277 |
| CYP3A4-inhibitor: | 0.431 | CYP3A4-substrate: | 0.825 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 5.491 | Half-life (T1/2): | 0.784 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.147 |
| Drug-inuced Liver Injury (DILI): | 0.721 | AMES Toxicity: | 0.543 |
| Rat Oral Acute Toxicity: | 0.14 | Maximum Recommended Daily Dose: | 0.971 |
| Skin Sensitization: | 0.044 | Carcinogencity: | 0.065 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.048 |
| Respiratory Toxicity: | 0.924 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004184 |  |
1.000 | D06GCK |  |
0.408 | ||
| ENC001571 |  |
0.400 | D02LZB |  |
0.358 | ||
| ENC005522 |  |
0.394 | D09DHY |  |
0.342 | ||
| ENC004820 |  |
0.384 | D0Y7TS |  |
0.333 | ||
| ENC001772 |  |
0.380 | D0AO5H |  |
0.323 | ||
| ENC001403 |  |
0.363 | D01FFA |  |
0.312 | ||
| ENC002897 |  |
0.359 | D04TDQ |  |
0.305 | ||
| ENC000168 |  |
0.356 | D0D4HN |  |
0.305 | ||
| ENC005868 |  |
0.348 | D0C1SF |  |
0.301 | ||
| ENC005977 |  |
0.343 | D0NJ3V |  |
0.296 | ||