![]() |
Name |
Quercetin 7,3',4'-trimethyl ether
|
Molecular Formula | C18H16O7 | |
IUPAC Name* |
2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one
|
|
SMILES |
COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)O)OC
|
|
InChI |
InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3
|
|
InChIKey |
OEEUHNAUMMATJT-UHFFFAOYSA-N
|
|
Synonyms |
6068-80-0; Quercetin 7,3',4'-trimethyl ether; 3',4',7-Trimethylquercetin; 3,5-Dihydroxy-7,3',4'-trimethoxyflavone; 347TRIMETHOXYQUERCETIN; 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one; 3',4',7-TRIMETHOXYQUERCETIN; CHEBI:70024; 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-chromen-4-one; 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-Benzopyran-4-one; SCHEMBL1250547; CHEMBL1689343; DTXSID00976115; HY-N7641; LMPK12112658; 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-; 3,5-dihydroxy-3',4',7-trimethoxyflavone; CS-0134915; Q27138366
|
|
CAS | 6068-80-0 | |
PubChem CID | 5748558 | |
ChEMBL ID | CHEMBL1689343 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 344.3 | ALogp: | 2.5 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.744 |
Caco-2 Permeability: | -4.849 | MDCK Permeability: | 0.00002350 |
Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.006 | Plasma Protein Binding (PPB): | 89.53% |
Volume Distribution (VD): | 0.832 | Fu: | 11.85% |
CYP1A2-inhibitor: | 0.932 | CYP1A2-substrate: | 0.961 |
CYP2C19-inhibitor: | 0.535 | CYP2C19-substrate: | 0.093 |
CYP2C9-inhibitor: | 0.714 | CYP2C9-substrate: | 0.889 |
CYP2D6-inhibitor: | 0.551 | CYP2D6-substrate: | 0.894 |
CYP3A4-inhibitor: | 0.64 | CYP3A4-substrate: | 0.213 |
Clearance (CL): | 5.119 | Half-life (T1/2): | 0.792 |
hERG Blockers: | 0.044 | Human Hepatotoxicity (H-HT): | 0.149 |
Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.541 |
Rat Oral Acute Toxicity: | 0.114 | Maximum Recommended Daily Dose: | 0.264 |
Skin Sensitization: | 0.236 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.341 |
Respiratory Toxicity: | 0.244 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001405 | ![]() |
0.527 | D06GCK | ![]() |
0.663 | ||
ENC001529 | ![]() |
0.518 | D0K8KX | ![]() |
0.518 | ||
ENC001751 | ![]() |
0.517 | D04AIT | ![]() |
0.366 | ||
ENC002205 | ![]() |
0.506 | D0NJ3V | ![]() |
0.359 | ||
ENC005647 | ![]() |
0.500 | D07MGA | ![]() |
0.340 | ||
ENC002134 | ![]() |
0.500 | D02LZB | ![]() |
0.333 | ||
ENC002523 | ![]() |
0.494 | D0Y7TS | ![]() |
0.321 | ||
ENC001750 | ![]() |
0.494 | D09DHY | ![]() |
0.319 | ||
ENC005522 | ![]() |
0.484 | D01FFA | ![]() |
0.312 | ||
ENC001631 | ![]() |
0.483 | D0W7JZ | ![]() |
0.311 |