![]() |
Name |
Simplicildone K
|
Molecular Formula | C32H34O8 | |
IUPAC Name* |
10-[[(3R,3aR,9aR)-7-hydroxy-3,5,8,9a-tetramethyl-2,3,3a,4-tetrahydrofuro[2,3-b]chromen-6-yl]methyl]-3,9-dihydroxy-1,4,7-trimethylbenzo[b][1,4]benzodioxepin-6-one
|
|
SMILES |
C[C@H]1CO[C@]2([C@@H]1CC3=C(C(=C(C(=C3O2)C)O)CC4=C(C=C(C5=C4OC6=C(C(=C(C=C6C)O)C)OC5=O)C)O)C)C
|
|
InChI |
InChI=1S/C32H34O8/c1-13-8-24(34)21(30-25(13)31(36)39-29-17(5)23(33)9-14(2)27(29)38-30)10-19-16(4)20-11-22-15(3)12-37-32(22,7)40-28(20)18(6)26(19)35/h8-9,15,22,33-35H,10-12H2,1-7H3/t15-,22+,32+/m0/s1
|
|
InChIKey |
BKGMYCGLQMQPCU-TUVZPUFFSA-N
|
|
Synonyms |
Simplicildone K
|
|
CAS | NA | |
PubChem CID | 146683463 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 546.6 | ALogp: | 6.6 |
HBD: | 3 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 115.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 40 | QED Weighted: | 0.257 |
Caco-2 Permeability: | -5.594 | MDCK Permeability: | 0.00002210 |
Pgp-inhibitor: | 0.799 | Pgp-substrate: | 0.399 |
Human Intestinal Absorption (HIA): | 0.38 | 20% Bioavailability (F20%): | 0.608 |
30% Bioavailability (F30%): | 0.695 |
Blood-Brain-Barrier Penetration (BBB): | 0.01 | Plasma Protein Binding (PPB): | 100.27% |
Volume Distribution (VD): | 0.38 | Fu: | 0.82% |
CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.942 |
CYP2C19-inhibitor: | 0.191 | CYP2C19-substrate: | 0.384 |
CYP2C9-inhibitor: | 0.228 | CYP2C9-substrate: | 0.858 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.334 |
CYP3A4-inhibitor: | 0.085 | CYP3A4-substrate: | 0.86 |
Clearance (CL): | 7.669 | Half-life (T1/2): | 0.207 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.321 |
Drug-inuced Liver Injury (DILI): | 0.854 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.96 | Maximum Recommended Daily Dose: | 0.939 |
Skin Sensitization: | 0.941 | Carcinogencity: | 0.099 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.899 |
Respiratory Toxicity: | 0.632 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003923 | ![]() |
0.563 | D03RTK | ![]() |
0.244 | ||
ENC003921 | ![]() |
0.556 | D06XZW | ![]() |
0.242 | ||
ENC003922 | ![]() |
0.556 | D0FX2Q | ![]() |
0.235 | ||
ENC002703 | ![]() |
0.513 | D0V6OA | ![]() |
0.230 | ||
ENC003917 | ![]() |
0.510 | D04ITO | ![]() |
0.223 | ||
ENC003919 | ![]() |
0.504 | D0G4OD | ![]() |
0.217 | ||
ENC003845 | ![]() |
0.500 | D0WY9N | ![]() |
0.216 | ||
ENC003920 | ![]() |
0.488 | D0G3DL | ![]() |
0.213 | ||
ENC003918 | ![]() |
0.487 | D08LTU | ![]() |
0.210 | ||
ENC003924 | ![]() |
0.478 | D05CHI | ![]() |
0.207 |