|
Name |
Simplicildone D
|
| Molecular Formula | C25H24O7 | |
| IUPAC Name* |
3,9-dihydroxy-10-[(2-hydroxy-4-methoxy-6-methylphenyl)methyl]-1,4,7-trimethylbenzo[b][1,4]benzodioxepin-6-one
|
|
| SMILES |
CC1=CC(=CC(=C1CC2=C(C=C(C3=C2OC4=C(C(=C(C=C4C)O)C)OC3=O)C)O)O)OC
|
|
| InChI |
InChI=1S/C25H24O7/c1-11-6-15(30-5)9-20(28)16(11)10-17-19(27)7-12(2)21-24(17)31-22-13(3)8-18(26)14(4)23(22)32-25(21)29/h6-9,26-28H,10H2,1-5H3
|
|
| InChIKey |
VFKCORLMSMHXLI-UHFFFAOYSA-N
|
|
| Synonyms |
Simplicildone D
|
|
| CAS | NA | |
| PubChem CID | 139590883 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 436.5 | ALogp: | 5.2 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 105.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 32 | QED Weighted: | 0.377 |
| Caco-2 Permeability: | -5.617 | MDCK Permeability: | 0.00002040 |
| Pgp-inhibitor: | 0.659 | Pgp-substrate: | 0.193 |
| Human Intestinal Absorption (HIA): | 0.149 | 20% Bioavailability (F20%): | 0.781 |
| 30% Bioavailability (F30%): | 0.35 |
| Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 99.41% |
| Volume Distribution (VD): | 0.427 | Fu: | 1.05% |
| CYP1A2-inhibitor: | 0.276 | CYP1A2-substrate: | 0.934 |
| CYP2C19-inhibitor: | 0.584 | CYP2C19-substrate: | 0.091 |
| CYP2C9-inhibitor: | 0.58 | CYP2C9-substrate: | 0.891 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.867 |
| CYP3A4-inhibitor: | 0.146 | CYP3A4-substrate: | 0.636 |
| Clearance (CL): | 10.839 | Half-life (T1/2): | 0.475 |
| hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.012 |
| Drug-inuced Liver Injury (DILI): | 0.38 | AMES Toxicity: | 0.063 |
| Rat Oral Acute Toxicity: | 0.983 | Maximum Recommended Daily Dose: | 0.959 |
| Skin Sensitization: | 0.929 | Carcinogencity: | 0.039 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.919 |
| Respiratory Toxicity: | 0.691 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003922 | ![]() |
0.832 | D07MGA | ![]() |
0.265 | ||
| ENC003917 | ![]() |
0.672 | D0AZ8C | ![]() |
0.250 | ||
| ENC003845 | ![]() |
0.652 | D04AIT | ![]() |
0.250 | ||
| ENC002703 | ![]() |
0.637 | D06GCK | ![]() |
0.248 | ||
| ENC003923 | ![]() |
0.636 | D0K8KX | ![]() |
0.246 | ||
| ENC003918 | ![]() |
0.615 | D0FA2O | ![]() |
0.241 | ||
| ENC003924 | ![]() |
0.556 | D03RTK | ![]() |
0.233 | ||
| ENC004137 | ![]() |
0.556 | D05HSC | ![]() |
0.229 | ||
| ENC002677 | ![]() |
0.552 | D0WY9N | ![]() |
0.224 | ||
| ENC004136 | ![]() |
0.540 | D01XNB | ![]() |
0.222 | ||