NPs Basic Information
|
Name |
Botryosulfuranol B
|
| Molecular Formula | C21H24N2O6S2 | |
| IUPAC Name* |
NA
|
|
| SMILES |
CN1C(=O)[C@]2([C@H]([C@]3(CCCCC3=O)ON2C(=O)[C@]14[C@H](C5=CC=CC=C5O4)SC)O)SC
|
|
| InChI |
InChI=1S/C21H24N2O6S2/c1-22-18(27)21(31-3)16(25)19(11-7-6-10-14(19)24)29-23(21)17(26)20(22)15(30-2)12-8-4-5-9-13(12)28-20/h4-5,8-9,15-16,25H,6-7,10-11H2,1-3H3/t15-,16-,19+,20+,21-/m0/s1
|
|
| InChIKey |
FFUFIKVVLJPVQD-KHDMTIDOSA-N
|
|
| Synonyms |
Botryosulfuranol B
|
|
| CAS | NA | |
| PubChem CID | 146682374 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 464.6 | ALogp: | 1.2 |
| HBD: | 1 | HBA: | 8 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 147.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 31 | QED Weighted: | 0.712 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.063 | MDCK Permeability: | 0.00002330 |
| Pgp-inhibitor: | 0.91 | Pgp-substrate: | 0.961 |
| Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.425 |
| 30% Bioavailability (F30%): | 0.875 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.94 | Plasma Protein Binding (PPB): | 90.48% |
| Volume Distribution (VD): | 1.095 | Fu: | 7.97% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.957 |
| CYP2C19-inhibitor: | 0.317 | CYP2C19-substrate: | 0.932 |
| CYP2C9-inhibitor: | 0.359 | CYP2C9-substrate: | 0.086 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.073 |
| CYP3A4-inhibitor: | 0.458 | CYP3A4-substrate: | 0.956 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.23 | Half-life (T1/2): | 0.112 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.261 |
| Drug-inuced Liver Injury (DILI): | 0.969 | AMES Toxicity: | 0.171 |
| Rat Oral Acute Toxicity: | 0.733 | Maximum Recommended Daily Dose: | 0.017 |
| Skin Sensitization: | 0.851 | Carcinogencity: | 0.976 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.49 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004039 |  |
0.755 | D0UM7O |  |
0.284 | ||
| ENC004041 |  |
0.487 | D08UMH |  |
0.239 | ||
| ENC003549 |  |
0.409 | D0L9ZR |  |
0.234 | ||
| ENC003595 |  |
0.374 | D00ETS |  |
0.234 | ||
| ENC003539 |  |
0.373 | D08EOD |  |
0.233 | ||
| ENC003546 |  |
0.373 | D0E3WQ |  |
0.231 | ||
| ENC003438 |  |
0.301 | D08UGJ |  |
0.231 | ||
| ENC004277 |  |
0.297 | D00JRA |  |
0.231 | ||
| ENC002538 |  |
0.291 | D0U7GK |  |
0.230 | ||
| ENC003035 |  |
0.288 | D09NNH |  |
0.230 | ||