|
Name |
6-O-propionyl-6,16-O-dideacetylhelvolic acid 21,16-lactone
|
| Molecular Formula | C32H42O6 | |
| IUPAC Name* |
[(1S,2S,4S,9R,12S,13R,17S,18S,19S)-1,2,13,17-tetramethyl-7-(4-methylpent-3-enyl)-6,16,20-trioxo-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-7,14-dien-19-yl] propanoate
|
|
| SMILES |
CCC(=O)O[C@H]1[C@H]2[C@@H](C(=O)C=C[C@@]2([C@@H]3CC[C@H]4C5=C(C(=O)O[C@H]5C[C@@]4([C@]3(C1=O)C)C)CCC=C(C)C)C)C
|
|
| InChI |
InChI=1S/C32H42O6/c1-8-24(34)38-27-26-18(4)21(33)14-15-30(26,5)23-13-12-20-25-19(11-9-10-17(2)3)29(36)37-22(25)16-31(20,6)32(23,7)28(27)35/h10,14-15,18,20,22-23,26-27H,8-9,11-13,16H2,1-7H3/t18-,20+,22+,23+,26-,27+,30-,31+,32-/m1/s1
|
|
| InChIKey |
ZNJSAZSREDLBFV-DGYAOCMVSA-N
|
|
| Synonyms |
CHEMBL4212440; 6-O-propionyl-6,16-O-dideacetylhelvolic acid 21,16-lactone
|
|
| CAS | NA | |
| PubChem CID | 139590095 | |
| ChEMBL ID | CHEMBL4212440 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 522.7 | ALogp: | 5.8 |
| HBD: | 0 | HBA: | 6 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 86.7 | Aromatic Rings: | 5 |
| Heavy Atoms: | 38 | QED Weighted: | 0.333 |
| Caco-2 Permeability: | -4.996 | MDCK Permeability: | 0.00002870 |
| Pgp-inhibitor: | 0.969 | Pgp-substrate: | 0.724 |
| Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 0.02 |
| 30% Bioavailability (F30%): | 0.126 |
| Blood-Brain-Barrier Penetration (BBB): | 0.897 | Plasma Protein Binding (PPB): | 98.12% |
| Volume Distribution (VD): | 2.168 | Fu: | 3.81% |
| CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.214 |
| CYP2C19-inhibitor: | 0.08 | CYP2C19-substrate: | 0.585 |
| CYP2C9-inhibitor: | 0.219 | CYP2C9-substrate: | 0.255 |
| CYP2D6-inhibitor: | 0.064 | CYP2D6-substrate: | 0.084 |
| CYP3A4-inhibitor: | 0.812 | CYP3A4-substrate: | 0.608 |
| Clearance (CL): | 16.214 | Half-life (T1/2): | 0.06 |
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.626 |
| Drug-inuced Liver Injury (DILI): | 0.596 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.977 | Maximum Recommended Daily Dose: | 0.925 |
| Skin Sensitization: | 0.258 | Carcinogencity: | 0.791 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
| Respiratory Toxicity: | 0.982 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003846 | ![]() |
0.897 | D0X7XG | ![]() |
0.295 | ||
| ENC005152 | ![]() |
0.636 | D09IEE | ![]() |
0.276 | ||
| ENC001480 | ![]() |
0.570 | D0D2TN | ![]() |
0.275 | ||
| ENC003484 | ![]() |
0.558 | D0X2LV | ![]() |
0.269 | ||
| ENC005487 | ![]() |
0.558 | D09WYX | ![]() |
0.265 | ||
| ENC003780 | ![]() |
0.557 | D00XPC | ![]() |
0.265 | ||
| ENC005151 | ![]() |
0.522 | D03SXE | ![]() |
0.250 | ||
| ENC005154 | ![]() |
0.507 | D0E9KA | ![]() |
0.250 | ||
| ENC005236 | ![]() |
0.507 | D01ZOG | ![]() |
0.250 | ||
| ENC005155 | ![]() |
0.496 | D09NNA | ![]() |
0.250 | ||