![]() |
Name |
Annulohypoxylomarin A
|
Molecular Formula | C11H14O2 | |
IUPAC Name* |
(3R)-3,7-dimethyl-3,4-dihydro-1H-isochromen-8-ol
|
|
SMILES |
C[C@@H]1CC2=C(CO1)C(=C(C=C2)C)O
|
|
InChI |
InChI=1S/C11H14O2/c1-7-3-4-9-5-8(2)13-6-10(9)11(7)12/h3-4,8,12H,5-6H2,1-2H3/t8-/m1/s1
|
|
InChIKey |
DUCHRZYTOZUUJA-MRVPVSSYSA-N
|
|
Synonyms |
Annulohypoxylomarin A
|
|
CAS | NA | |
PubChem CID | 139589657 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 178.23 | ALogp: | 2.0 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 29.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 13 | QED Weighted: | 0.662 |
Caco-2 Permeability: | -4.475 | MDCK Permeability: | 0.00003340 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.087 |
Blood-Brain-Barrier Penetration (BBB): | 0.869 | Plasma Protein Binding (PPB): | 81.08% |
Volume Distribution (VD): | 1.726 | Fu: | 14.65% |
CYP1A2-inhibitor: | 0.692 | CYP1A2-substrate: | 0.884 |
CYP2C19-inhibitor: | 0.218 | CYP2C19-substrate: | 0.78 |
CYP2C9-inhibitor: | 0.075 | CYP2C9-substrate: | 0.564 |
CYP2D6-inhibitor: | 0.08 | CYP2D6-substrate: | 0.84 |
CYP3A4-inhibitor: | 0.034 | CYP3A4-substrate: | 0.438 |
Clearance (CL): | 11.391 | Half-life (T1/2): | 0.749 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.604 |
Drug-inuced Liver Injury (DILI): | 0.104 | AMES Toxicity: | 0.821 |
Rat Oral Acute Toxicity: | 0.312 | Maximum Recommended Daily Dose: | 0.459 |
Skin Sensitization: | 0.864 | Carcinogencity: | 0.866 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.839 |
Respiratory Toxicity: | 0.322 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002309 | ![]() |
0.423 | D03XES | ![]() |
0.250 | ||
ENC004210 | ![]() |
0.365 | D0N0OU | ![]() |
0.240 | ||
ENC000856 | ![]() |
0.358 | D0H6QU | ![]() |
0.240 | ||
ENC000907 | ![]() |
0.358 | D01JMC | ![]() |
0.237 | ||
ENC002082 | ![]() |
0.358 | D0W6DG | ![]() |
0.237 | ||
ENC000584 | ![]() |
0.358 | D0WE3O | ![]() |
0.231 | ||
ENC001305 | ![]() |
0.351 | D04JHN | ![]() |
0.231 | ||
ENC006091 | ![]() |
0.345 | D06GIP | ![]() |
0.226 | ||
ENC005119 | ![]() |
0.329 | D0P6VV | ![]() |
0.225 | ||
ENC003393 | ![]() |
0.328 | D02NSF | ![]() |
0.225 |