![]() |
Name |
Glucopiericidinol A3
|
Molecular Formula | C37H57NO14 | |
IUPAC Name* |
2,3-dimethoxy-5-methyl-6-[(9R,10R)-3,7,9,11-tetramethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxytrideca-2,5,7,11-tetraenyl]-1H-pyridin-4-one
|
|
SMILES |
CC=C(C)[C@@H]([C@H](C)C=C(C)C=CCC(=CCC1=C(C(=O)C(=C(N1)OC)OC)C)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O)O
|
|
InChI |
InChI=1S/C37H57NO14/c1-9-20(4)33(21(5)15-19(3)12-10-11-18(2)13-14-23-22(6)26(40)34(47-7)35(38-23)48-8)52-37-32(46)30(44)28(42)25(51-37)17-49-36-31(45)29(43)27(41)24(16-39)50-36/h9-10,12-13,15,21,24-25,27-33,36-37,39,41-46H,11,14,16-17H2,1-8H3,(H,38,40)/t21-,24-,25-,27+,28-,29+,30+,31-,32-,33+,36+,37+/m1/s1
|
|
InChIKey |
ONDJAWAPNLRFQC-KJUBBQSVSA-N
|
|
Synonyms |
Glucopiericidinol A3
|
|
CAS | NA | |
PubChem CID | 139589534 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 739.8 | ALogp: | 2.4 |
HBD: | 8 | HBA: | 15 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 226.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 52 | QED Weighted: | 0.088 |
Caco-2 Permeability: | -5.739 | MDCK Permeability: | 0.00002490 |
Pgp-inhibitor: | 0.968 | Pgp-substrate: | 0.999 |
Human Intestinal Absorption (HIA): | 0.878 | 20% Bioavailability (F20%): | 0.055 |
30% Bioavailability (F30%): | 0.899 |
Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 69.08% |
Volume Distribution (VD): | 0.855 | Fu: | 9.37% |
CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.199 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.44 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.046 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.151 |
CYP3A4-inhibitor: | 0.094 | CYP3A4-substrate: | 0.174 |
Clearance (CL): | 1.05 | Half-life (T1/2): | 0.824 |
hERG Blockers: | 0.093 | Human Hepatotoxicity (H-HT): | 0.756 |
Drug-inuced Liver Injury (DILI): | 0.041 | AMES Toxicity: | 0.114 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.112 |
Skin Sensitization: | 0.871 | Carcinogencity: | 0.021 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003819 | ![]() |
0.866 | D0TC7C | ![]() |
0.335 | ||
ENC004854 | ![]() |
0.806 | D0I9HF | ![]() |
0.323 | ||
ENC002660 | ![]() |
0.786 | D0A8RX | ![]() |
0.312 | ||
ENC004855 | ![]() |
0.518 | D0Y3MO | ![]() |
0.286 | ||
ENC001847 | ![]() |
0.517 | D0YV1Q | ![]() |
0.281 | ||
ENC002949 | ![]() |
0.331 | D0P2IT | ![]() |
0.274 | ||
ENC002950 | ![]() |
0.331 | D07QQD | ![]() |
0.271 | ||
ENC003397 | ![]() |
0.324 | D07BSE | ![]() |
0.259 | ||
ENC002269 | ![]() |
0.315 | D04MRG | ![]() |
0.258 | ||
ENC001546 | ![]() |
0.311 | D04NDM | ![]() |
0.252 |