![]() |
Name |
Glucopiericidin A
|
Molecular Formula | C31H47NO9 | |
IUPAC Name* |
2,3-dimethoxy-5-methyl-6-[(2E,5E,7E,9R,10R,11E)-3,7,9,11-tetramethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytrideca-2,5,7,11-tetraenyl]-1H-pyridin-4-one
|
|
SMILES |
C/C=C(\C)/[C@@H]([C@H](C)/C=C(\C)/C=C/C/C(=C/CC1=C(C(=O)C(=C(N1)OC)OC)C)/C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
|
|
InChI |
InChI=1S/C31H47NO9/c1-9-19(4)28(41-31-27(37)26(36)25(35)23(16-33)40-31)20(5)15-18(3)12-10-11-17(2)13-14-22-21(6)24(34)29(38-7)30(32-22)39-8/h9-10,12-13,15,20,23,25-28,31,33,35-37H,11,14,16H2,1-8H3,(H,32,34)/b12-10+,17-13+,18-15+,19-9+/t20-,23-,25-,26+,27-,28+,31+/m1/s1
|
|
InChIKey |
YQOARHMNLCWEPG-DFTUVXBYSA-N
|
|
Synonyms |
Glucopiericidin A; CHEMBL4092369; 108073-65-0; BDBM50504090; 10'-O-beta-D-Glucopyranosylpiercidin A1
|
|
CAS | NA | |
PubChem CID | 44608046 | |
ChEMBL ID | CHEMBL4092369 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 577.7 | ALogp: | 4.5 |
HBD: | 5 | HBA: | 10 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 147.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 41 | QED Weighted: | 0.175 |
Caco-2 Permeability: | -5.032 | MDCK Permeability: | 0.00001810 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.995 |
Human Intestinal Absorption (HIA): | 0.382 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.022 |
Blood-Brain-Barrier Penetration (BBB): | 0.037 | Plasma Protein Binding (PPB): | 95.41% |
Volume Distribution (VD): | 0.703 | Fu: | 3.19% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.437 |
CYP2C19-inhibitor: | 0.052 | CYP2C19-substrate: | 0.735 |
CYP2C9-inhibitor: | 0.028 | CYP2C9-substrate: | 0.503 |
CYP2D6-inhibitor: | 0.322 | CYP2D6-substrate: | 0.687 |
CYP3A4-inhibitor: | 0.461 | CYP3A4-substrate: | 0.719 |
Clearance (CL): | 2.685 | Half-life (T1/2): | 0.827 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.258 |
Drug-inuced Liver Injury (DILI): | 0.52 | AMES Toxicity: | 0.045 |
Rat Oral Acute Toxicity: | 0.007 | Maximum Recommended Daily Dose: | 0.119 |
Skin Sensitization: | 0.836 | Carcinogencity: | 0.015 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.016 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003820 | ![]() |
0.786 | D06BQU | ![]() |
0.241 | ||
ENC003819 | ![]() |
0.664 | D02VCJ | ![]() |
0.237 | ||
ENC001847 | ![]() |
0.652 | D0S0NK | ![]() |
0.229 | ||
ENC004854 | ![]() |
0.613 | D05ZYM | ![]() |
0.221 | ||
ENC004855 | ![]() |
0.609 | D01TNW | ![]() |
0.221 | ||
ENC001625 | ![]() |
0.313 | D0T5BC | ![]() |
0.220 | ||
ENC005616 | ![]() |
0.301 | D0D0SH | ![]() |
0.218 | ||
ENC003441 | ![]() |
0.296 | D0B1IP | ![]() |
0.216 | ||
ENC002839 | ![]() |
0.292 | D0H3KI | ![]() |
0.216 | ||
ENC004780 | ![]() |
0.292 | D03TGJ | ![]() |
0.215 |