![]() |
Name |
2'-Acetoxy-7-chlorocitreorosein
|
Molecular Formula | C18H13ClO7 | |
IUPAC Name* |
(6-chloro-4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)methyl acetate
|
|
SMILES |
CC(=O)OCC1=CC2=C(C(=C1)O)C(=O)C3=C(C(=C(C=C3C2=O)O)Cl)OC
|
|
InChI |
InChI=1S/C18H13ClO7/c1-7(20)26-6-8-3-9-13(11(21)4-8)17(24)14-10(16(9)23)5-12(22)15(19)18(14)25-2/h3-5,21-22H,6H2,1-2H3
|
|
InChIKey |
OWTNKMFURYLDCW-UHFFFAOYSA-N
|
|
Synonyms |
2'-acetoxy-7-chlorocitreorosein
|
|
CAS | NA | |
PubChem CID | 139589444 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 376.7 | ALogp: | 3.0 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 110.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.674 |
Caco-2 Permeability: | -4.97 | MDCK Permeability: | 0.00001610 |
Pgp-inhibitor: | 0.605 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.055 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.879 |
Blood-Brain-Barrier Penetration (BBB): | 0.04 | Plasma Protein Binding (PPB): | 97.94% |
Volume Distribution (VD): | 0.645 | Fu: | 3.14% |
CYP1A2-inhibitor: | 0.864 | CYP1A2-substrate: | 0.669 |
CYP2C19-inhibitor: | 0.173 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.728 | CYP2C9-substrate: | 0.332 |
CYP2D6-inhibitor: | 0.25 | CYP2D6-substrate: | 0.163 |
CYP3A4-inhibitor: | 0.416 | CYP3A4-substrate: | 0.176 |
Clearance (CL): | 4.752 | Half-life (T1/2): | 0.358 |
hERG Blockers: | 0.069 | Human Hepatotoxicity (H-HT): | 0.081 |
Drug-inuced Liver Injury (DILI): | 0.945 | AMES Toxicity: | 0.769 |
Rat Oral Acute Toxicity: | 0.287 | Maximum Recommended Daily Dose: | 0.604 |
Skin Sensitization: | 0.072 | Carcinogencity: | 0.294 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.917 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003915 | ![]() |
0.725 | D0N1FS | ![]() |
0.349 | ||
ENC005490 | ![]() |
0.553 | D06GCK | ![]() |
0.287 | ||
ENC001497 | ![]() |
0.548 | D01XWG | ![]() |
0.281 | ||
ENC005280 | ![]() |
0.538 | D07VLY | ![]() |
0.275 | ||
ENC002767 | ![]() |
0.535 | D0C9XJ | ![]() |
0.275 | ||
ENC002229 | ![]() |
0.534 | D07MGA | ![]() |
0.272 | ||
ENC000913 | ![]() |
0.529 | D01XDL | ![]() |
0.254 | ||
ENC002766 | ![]() |
0.518 | D0U0OT | ![]() |
0.250 | ||
ENC000362 | ![]() |
0.512 | D09DHY | ![]() |
0.250 | ||
ENC005602 | ![]() |
0.512 | D08FPM | ![]() |
0.248 |