![]() |
Name |
Conidiogenone I
|
Molecular Formula | C20H32O3 | |
IUPAC Name* |
(1R,2R,3R,6R,9S,10S,11S,14R)-3-hydroxy-11-(hydroxymethyl)-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadecan-5-one
|
|
SMILES |
C[C@H]1[C@@H](CC(=O)[C@]2([C@@]13C[C@]4(CC[C@]([C@H]4[C@@H]3CC2)(C)CO)C)C)O
|
|
InChI |
InChI=1S/C20H32O3/c1-12-14(22)9-15(23)19(4)6-5-13-16-17(2,10-20(12,13)19)7-8-18(16,3)11-21/h12-14,16,21-22H,5-11H2,1-4H3/t12-,13-,14+,16-,17+,18+,19-,20-/m0/s1
|
|
InChIKey |
OSAXTPCZBXLUPQ-BQRZXHGPSA-N
|
|
Synonyms |
Conidiogenone I; CHEMBL4209351
|
|
CAS | NA | |
PubChem CID | 139588589 | |
ChEMBL ID | CHEMBL4209351 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.5 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 4 |
Heavy Atoms: | 23 | QED Weighted: | 0.769 |
Caco-2 Permeability: | -4.766 | MDCK Permeability: | 0.00001760 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.428 |
Blood-Brain-Barrier Penetration (BBB): | 0.873 | Plasma Protein Binding (PPB): | 73.73% |
Volume Distribution (VD): | 0.662 | Fu: | 18.54% |
CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.645 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.894 |
CYP2C9-inhibitor: | 0.083 | CYP2C9-substrate: | 0.114 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.104 |
CYP3A4-inhibitor: | 0.903 | CYP3A4-substrate: | 0.529 |
Clearance (CL): | 6.6 | Half-life (T1/2): | 0.711 |
hERG Blockers: | 0.204 | Human Hepatotoxicity (H-HT): | 0.269 |
Drug-inuced Liver Injury (DILI): | 0.144 | AMES Toxicity: | 0.023 |
Rat Oral Acute Toxicity: | 0.116 | Maximum Recommended Daily Dose: | 0.03 |
Skin Sensitization: | 0.651 | Carcinogencity: | 0.235 |
Eye Corrosion: | 0.256 | Eye Irritation: | 0.433 |
Respiratory Toxicity: | 0.962 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005300 | ![]() |
0.649 | D0L2LS | ![]() |
0.323 | ||
ENC002539 | ![]() |
0.649 | D0H1QY | ![]() |
0.319 | ||
ENC003581 | ![]() |
0.618 | D0U3GL | ![]() |
0.309 | ||
ENC002099 | ![]() |
0.532 | D0Q6NZ | ![]() |
0.306 | ||
ENC002545 | ![]() |
0.488 | D0KR5B | ![]() |
0.304 | ||
ENC002546 | ![]() |
0.440 | D0K0EK | ![]() |
0.301 | ||
ENC002547 | ![]() |
0.424 | D0I2SD | ![]() |
0.300 | ||
ENC004125 | ![]() |
0.407 | D0R7JT | ![]() |
0.298 | ||
ENC003219 | ![]() |
0.368 | D0Z1XD | ![]() |
0.295 | ||
ENC004410 | ![]() |
0.360 | D04DJN | ![]() |
0.287 |