![]() |
Name |
Conidiogenone G
|
Molecular Formula | C20H30O2 | |
IUPAC Name* |
(1R,2R,6S,8R,9R,10S,14S)-8-hydroxy-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one
|
|
SMILES |
C[C@@H]1C=CC(=O)[C@@]2([C@]13C[C@@]4(CCC([C@@H]4[C@H]3[C@@H](C2)O)(C)C)C)C
|
|
InChI |
InChI=1S/C20H30O2/c1-12-6-7-14(22)19(5)10-13(21)15-16-17(2,3)8-9-18(16,4)11-20(12,15)19/h6-7,12-13,15-16,21H,8-11H2,1-5H3/t12-,13-,15-,16+,18+,19-,20-/m1/s1
|
|
InChIKey |
YSBBDAHDCXMXID-SZBDGJFISA-N
|
|
Synonyms |
Conidiogenone G
|
|
CAS | NA | |
PubChem CID | 25223314 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 302.5 | ALogp: | 4.4 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 22 | QED Weighted: | 0.709 |
Caco-2 Permeability: | -4.854 | MDCK Permeability: | 0.00001440 |
Pgp-inhibitor: | 0.203 | Pgp-substrate: | 0.16 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.694 |
30% Bioavailability (F30%): | 0.889 |
Blood-Brain-Barrier Penetration (BBB): | 0.524 | Plasma Protein Binding (PPB): | 83.48% |
Volume Distribution (VD): | 1.062 | Fu: | 22.63% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.676 |
CYP2C19-inhibitor: | 0.123 | CYP2C19-substrate: | 0.877 |
CYP2C9-inhibitor: | 0.146 | CYP2C9-substrate: | 0.138 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.073 |
CYP3A4-inhibitor: | 0.891 | CYP3A4-substrate: | 0.538 |
Clearance (CL): | 16.012 | Half-life (T1/2): | 0.319 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.384 |
Drug-inuced Liver Injury (DILI): | 0.098 | AMES Toxicity: | 0.017 |
Rat Oral Acute Toxicity: | 0.914 | Maximum Recommended Daily Dose: | 0.43 |
Skin Sensitization: | 0.062 | Carcinogencity: | 0.885 |
Eye Corrosion: | 0.468 | Eye Irritation: | 0.047 |
Respiratory Toxicity: | 0.975 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002545 | ![]() |
0.681 | D0D2TN | ![]() |
0.320 | ||
ENC002546 | ![]() |
0.616 | D08PIQ | ![]() |
0.294 | ||
ENC005300 | ![]() |
0.566 | D02JNM | ![]() |
0.294 | ||
ENC002539 | ![]() |
0.566 | D0P0HT | ![]() |
0.284 | ||
ENC004125 | ![]() |
0.532 | D04SFH | ![]() |
0.283 | ||
ENC002099 | ![]() |
0.457 | D0L2LS | ![]() |
0.278 | ||
ENC003804 | ![]() |
0.424 | D0Y2YP | ![]() |
0.277 | ||
ENC003581 | ![]() |
0.412 | D0D1SG | ![]() |
0.275 | ||
ENC003219 | ![]() |
0.333 | D0V9DZ | ![]() |
0.269 | ||
ENC004409 | ![]() |
0.326 | D0F1EX | ![]() |
0.264 |