![]() |
Name |
Pestalafuranone D
|
Molecular Formula | C11H14O3 | |
IUPAC Name* |
3-[[(2R,3R)-3-methyloxiran-2-yl]methyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one
|
|
SMILES |
C/C=C/C1=C(COC1=O)C[C@@H]2[C@H](O2)C
|
|
InChI |
InChI=1S/C11H14O3/c1-3-4-9-8(6-13-11(9)12)5-10-7(2)14-10/h3-4,7,10H,5-6H2,1-2H3/b4-3+/t7-,10-/m1/s1
|
|
InChIKey |
PFFWZSSMEHECNX-VGVKBVLKSA-N
|
|
Synonyms |
Pestalafuranone D
|
|
CAS | NA | |
PubChem CID | 139587431 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.23 | ALogp: | 1.2 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.51 |
Caco-2 Permeability: | -4.638 | MDCK Permeability: | 0.00002240 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.236 |
Blood-Brain-Barrier Penetration (BBB): | 0.209 | Plasma Protein Binding (PPB): | 95.04% |
Volume Distribution (VD): | 2.251 | Fu: | 3.93% |
CYP1A2-inhibitor: | 0.219 | CYP1A2-substrate: | 0.352 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.353 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.524 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.763 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.29 |
Clearance (CL): | 10.508 | Half-life (T1/2): | 0.751 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.773 |
Drug-inuced Liver Injury (DILI): | 0.2 | AMES Toxicity: | 0.106 |
Rat Oral Acute Toxicity: | 0.942 | Maximum Recommended Daily Dose: | 0.259 |
Skin Sensitization: | 0.836 | Carcinogencity: | 0.891 |
Eye Corrosion: | 0.049 | Eye Irritation: | 0.59 |
Respiratory Toxicity: | 0.922 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003204 | ![]() |
0.520 | D06HLY | ![]() |
0.194 | ||
ENC003036 | ![]() |
0.407 | D0R2KF | ![]() |
0.187 | ||
ENC005984 | ![]() |
0.323 | D0CL9S | ![]() |
0.183 | ||
ENC003681 | ![]() |
0.322 | D03TGJ | ![]() |
0.179 | ||
ENC004982 | ![]() |
0.302 | D0G6AB | ![]() |
0.176 | ||
ENC005499 | ![]() |
0.300 | D0A2AJ | ![]() |
0.173 | ||
ENC001753 | ![]() |
0.292 | D03KXY | ![]() |
0.169 | ||
ENC003726 | ![]() |
0.273 | D01XYJ | ![]() |
0.169 | ||
ENC003654 | ![]() |
0.267 | D0TS1Z | ![]() |
0.167 | ||
ENC006135 | ![]() |
0.262 | D09PZO | ![]() |
0.167 |