|
Name |
3-[(E)-1-Propenyl]-4-[(E)-3-hydroxy-1-butenyl]furan-2(5H)-one
|
| Molecular Formula | C11H14O3 | |
| IUPAC Name* |
3-[(E)-3-hydroxybut-1-enyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one
|
|
| SMILES |
C/C=C/C1=C(COC1=O)/C=C/C(C)O
|
|
| InChI |
InChI=1S/C11H14O3/c1-3-4-10-9(6-5-8(2)12)7-14-11(10)13/h3-6,8,12H,7H2,1-2H3/b4-3+,6-5+
|
|
| InChIKey |
YMVSQSLGMRTXPS-VNKDHWASSA-N
|
|
| Synonyms |
Pestalafuranone B; 3-[(E)-1-Propenyl]-4-[(E)-3-hydroxy-1-butenyl]furan-2(5H)-one; 3-[(E)-3-hydroxybut-1-enyl]-4-[(E)-prop-1-enyl]-2H-furan-5-one
|
|
| CAS | NA | |
| PubChem CID | 86573697 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 194.23 | ALogp: | 0.9 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 14 | QED Weighted: | 0.697 |
| Caco-2 Permeability: | -4.633 | MDCK Permeability: | 0.00002610 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.009 |
| Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.254 | Plasma Protein Binding (PPB): | 96.10% |
| Volume Distribution (VD): | 1.491 | Fu: | 4.04% |
| CYP1A2-inhibitor: | 0.276 | CYP1A2-substrate: | 0.645 |
| CYP2C19-inhibitor: | 0.044 | CYP2C19-substrate: | 0.1 |
| CYP2C9-inhibitor: | 0.029 | CYP2C9-substrate: | 0.885 |
| CYP2D6-inhibitor: | 0.063 | CYP2D6-substrate: | 0.906 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.216 |
| Clearance (CL): | 12.747 | Half-life (T1/2): | 0.893 |
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.588 |
| Drug-inuced Liver Injury (DILI): | 0.111 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.582 | Maximum Recommended Daily Dose: | 0.377 |
| Skin Sensitization: | 0.85 | Carcinogencity: | 0.935 |
| Eye Corrosion: | 0.318 | Eye Irritation: | 0.558 |
| Respiratory Toxicity: | 0.32 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003744 | ![]() |
0.407 | D02XSA | ![]() |
0.214 | ||
| ENC003204 | ![]() |
0.407 | D07AHW | ![]() |
0.169 | ||
| ENC005984 | ![]() |
0.390 | D0YX4S | ![]() |
0.167 | ||
| ENC003951 | ![]() |
0.338 | D0H6VY | ![]() |
0.156 | ||
| ENC004049 | ![]() |
0.273 | D0R2KF | ![]() |
0.156 | ||
| ENC005500 | ![]() |
0.266 | D0N3NO | ![]() |
0.155 | ||
| ENC003757 | ![]() |
0.257 | D02IIW | ![]() |
0.154 | ||
| ENC001538 | ![]() |
0.254 | D0Q4TK | ![]() |
0.154 | ||
| ENC003622 | ![]() |
0.250 | D0Q9YT | ![]() |
0.151 | ||
| ENC005499 | ![]() |
0.250 | D0H3TD | ![]() |
0.150 | ||