|
Name |
(11)-Cytochalasa-6(12),13-diene-1,21-dione-16,18-dimethyl-7-hydroxy-lO-phenyl-(7S*,13E,16S*,18S*)
|
| Molecular Formula | C28H37NO3 | |
| IUPAC Name* |
(1S,5R,7S,9E,11S,12R,14R,15S,16R)-16-benzyl-12-hydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadec-9-ene-2,18-dione
|
|
| SMILES |
C[C@@H]1CCC(=O)[C@@]23[C@H](/C=C/C[C@H](C1)C)[C@H](C(=C)[C@@H]([C@@H]2[C@H](NC3=O)CC4=CC=CC=C4)C)O
|
|
| InChI |
InChI=1S/C28H37NO3/c1-17-9-8-12-22-26(31)20(4)19(3)25-23(16-21-10-6-5-7-11-21)29-27(32)28(22,25)24(30)14-13-18(2)15-17/h5-8,10-12,17-19,22-23,25-26,31H,4,9,13-16H2,1-3H3,(H,29,32)/b12-8+/t17-,18-,19+,22-,23-,25-,26+,28+/m1/s1
|
|
| InChIKey |
PTFNSBGUGCYQFN-NWKGAVBNSA-N
|
|
| Synonyms |
(11)-Cytochalasa-6(12),13-diene-1,21-dione-16,18-dimethyl-7-hydroxy-lO-phenyl-(7S*,13E,16S*,18S*)
|
|
| CAS | NA | |
| PubChem CID | 139586260 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 435.6 | ALogp: | 4.1 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.4 | Aromatic Rings: | 4 |
| Heavy Atoms: | 32 | QED Weighted: | 0.508 |
| Caco-2 Permeability: | -4.768 | MDCK Permeability: | 0.00001950 |
| Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0.891 |
| Human Intestinal Absorption (HIA): | 0.278 | 20% Bioavailability (F20%): | 0.112 |
| 30% Bioavailability (F30%): | 0.018 |
| Blood-Brain-Barrier Penetration (BBB): | 0.925 | Plasma Protein Binding (PPB): | 97.47% |
| Volume Distribution (VD): | 1.299 | Fu: | 2.63% |
| CYP1A2-inhibitor: | 0.217 | CYP1A2-substrate: | 0.125 |
| CYP2C19-inhibitor: | 0.942 | CYP2C19-substrate: | 0.432 |
| CYP2C9-inhibitor: | 0.901 | CYP2C9-substrate: | 0.544 |
| CYP2D6-inhibitor: | 0.071 | CYP2D6-substrate: | 0.12 |
| CYP3A4-inhibitor: | 0.934 | CYP3A4-substrate: | 0.444 |
| Clearance (CL): | 7.138 | Half-life (T1/2): | 0.177 |
| hERG Blockers: | 0.088 | Human Hepatotoxicity (H-HT): | 0.61 |
| Drug-inuced Liver Injury (DILI): | 0.304 | AMES Toxicity: | 0.02 |
| Rat Oral Acute Toxicity: | 0.896 | Maximum Recommended Daily Dose: | 0.879 |
| Skin Sensitization: | 0.574 | Carcinogencity: | 0.198 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.957 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005761 | ![]() |
0.682 | D06CWH | ![]() |
0.270 | ||
| ENC006133 | ![]() |
0.648 | D0V3ZA | ![]() |
0.269 | ||
| ENC004745 | ![]() |
0.621 | D09NNH | ![]() |
0.269 | ||
| ENC004243 | ![]() |
0.593 | D0TB8C | ![]() |
0.266 | ||
| ENC002183 | ![]() |
0.591 | D0Z9NZ | ![]() |
0.264 | ||
| ENC004544 | ![]() |
0.578 | D0SP3D | ![]() |
0.261 | ||
| ENC004918 | ![]() |
0.578 | D01TSI | ![]() |
0.254 | ||
| ENC004447 | ![]() |
0.576 | D0I0DL | ![]() |
0.254 | ||
| ENC002682 | ![]() |
0.576 | D0IN7I | ![]() |
0.250 | ||
| ENC003955 | ![]() |
0.575 | D0NS6H | ![]() |
0.250 | ||