|
Name |
3-Oxo-4alpha-isobutyl-3,4-dihydro1H-pyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde
|
| Molecular Formula | C12H15NO3 | |
| IUPAC Name* |
(4S)-4-(2-methylpropyl)-3-oxo-1,4-dihydropyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde
|
|
| SMILES |
CC(C)C[C@H]1C(=O)OCC2=CC=C(N12)C=O
|
|
| InChI |
InChI=1S/C12H15NO3/c1-8(2)5-11-12(15)16-7-10-4-3-9(6-14)13(10)11/h3-4,6,8,11H,5,7H2,1-2H3/t11-/m0/s1
|
|
| InChIKey |
JIDALDBSXBQUJI-NSHDSACASA-N
|
|
| Synonyms |
J3.530.769I; (S)-4-isobutyl-3-oxo-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde; 3-Oxo-4alpha-isobutyl-3,4-dihydro1H-pyrrolo[2,1-c][1,4]oxazine-6-carbaldehyde
|
|
| CAS | NA | |
| PubChem CID | 132594744 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 221.25 | ALogp: | 1.8 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 48.3 | Aromatic Rings: | 2 |
| Heavy Atoms: | 16 | QED Weighted: | 0.582 |
| Caco-2 Permeability: | -4.509 | MDCK Permeability: | 0.00003370 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.002 |
| Blood-Brain-Barrier Penetration (BBB): | 0.83 | Plasma Protein Binding (PPB): | 34.11% |
| Volume Distribution (VD): | 1.06 | Fu: | 64.35% |
| CYP1A2-inhibitor: | 0.865 | CYP1A2-substrate: | 0.091 |
| CYP2C19-inhibitor: | 0.82 | CYP2C19-substrate: | 0.541 |
| CYP2C9-inhibitor: | 0.614 | CYP2C9-substrate: | 0.633 |
| CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.266 |
| CYP3A4-inhibitor: | 0.094 | CYP3A4-substrate: | 0.337 |
| Clearance (CL): | 11.044 | Half-life (T1/2): | 0.637 |
| hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.146 |
| Drug-inuced Liver Injury (DILI): | 0.755 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.483 |
| Skin Sensitization: | 0.155 | Carcinogencity: | 0.232 |
| Eye Corrosion: | 0.008 | Eye Irritation: | 0.434 |
| Respiratory Toxicity: | 0.369 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003324 | ![]() |
0.523 | D0R2KF | ![]() |
0.218 | ||
| ENC004822 | ![]() |
0.280 | D09PJX | ![]() |
0.213 | ||
| ENC001970 | ![]() |
0.280 | D06HLY | ![]() |
0.211 | ||
| ENC001909 | ![]() |
0.260 | D0W1QI | ![]() |
0.207 | ||
| ENC005470 | ![]() |
0.256 | D06BYV | ![]() |
0.203 | ||
| ENC000026 | ![]() |
0.254 | D03CUF | ![]() |
0.203 | ||
| ENC005999 | ![]() |
0.253 | D0R1QE | ![]() |
0.200 | ||
| ENC005848 | ![]() |
0.250 | D06IXT | ![]() |
0.200 | ||
| ENC000834 | ![]() |
0.250 | D09SSC | ![]() |
0.200 | ||
| ENC001907 | ![]() |
0.250 | D08EOD | ![]() |
0.197 | ||