![]() |
Name |
3-Isobutylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
Molecular Formula | C11H18N2O2 | |
IUPAC Name* |
3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
SMILES |
CC(C)CC1C(=O)N2CCCC2C(=O)N1
|
|
InChI |
InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)
|
|
InChIKey |
SZJNCZMRZAUNQT-UHFFFAOYSA-N
|
|
Synonyms |
5654-86-4; 3-Isobutylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione; Cyclo(Pro-Leu); Cyclo(leucyloprolyl); 3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(2-methylpropyl)-; 3-(2-methylpropyl)-octahydropyrrolo[1,2-a]piperazine-1,4-dione; Pyrrolo(1,2-a)pyrazine-1,4-dione, hexahydro-3-(2-methylpropyl)-; KQV8MY059B; EINECS 220-710-6; BRN 0085716; Cyclo-L-prolyl-L-leucine; UNII-KQV8MY059B; SCHEMBL168687; ACon0_000484; ACon1_000716; DTXSID80951384; (3S-trans)-Hexahydro-3-isobutylpyrrolo(1,2-a)pyrazine-1,4-dione; Pyrrolo(1,2-a)pyrazine-1,4-dione, hexahydro-3-isobutyl-, stereoisomer; (3S,8aS)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione; Pyrrolo(1,2-a)pyrazine-1,4-dione, hexahydro-3-(2-methylpropyl)-, (3S-trans)-; CYCLIC DIPEPTIDE WITH PROLINE ;;; NCGC00169428-01; FT-0665321; EN300-9434147; 5-24-07-00347 (Beilstein Handbook Reference); A876644; 3-Isobutyloctahydropyrrolo[1,2-a]pyrazine-1,4-dione; BRD-A04763029-001-01-1; 1-Hydroxy-3-(2-methylpropyl)-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-4(3H)-one; NCGC00169428-02!3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
|
|
CAS | 2873-36-1 | |
PubChem CID | 102892 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 210.27 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.736 |
Caco-2 Permeability: | -4.581 | MDCK Permeability: | 0.00002450 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.849 | Plasma Protein Binding (PPB): | 16.10% |
Volume Distribution (VD): | 0.722 | Fu: | 71.26% |
CYP1A2-inhibitor: | 0.027 | CYP1A2-substrate: | 0.152 |
CYP2C19-inhibitor: | 0.104 | CYP2C19-substrate: | 0.716 |
CYP2C9-inhibitor: | 0.046 | CYP2C9-substrate: | 0.868 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.281 |
CYP3A4-inhibitor: | 0.049 | CYP3A4-substrate: | 0.257 |
Clearance (CL): | 7.012 | Half-life (T1/2): | 0.677 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.749 |
Drug-inuced Liver Injury (DILI): | 0.233 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.397 | Maximum Recommended Daily Dose: | 0.051 |
Skin Sensitization: | 0.169 | Carcinogencity: | 0.044 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.026 |
Respiratory Toxicity: | 0.043 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005974 | ![]() |
1.000 | D09PJX | ![]() |
0.250 | ||
ENC005708 | ![]() |
1.000 | D0I0EG | ![]() |
0.238 | ||
ENC001907 | ![]() |
1.000 | D06YFA | ![]() |
0.231 | ||
ENC005207 | ![]() |
0.681 | D0R2KF | ![]() |
0.227 | ||
ENC005973 | ![]() |
0.681 | D02IIW | ![]() |
0.224 | ||
ENC005409 | ![]() |
0.681 | D0Q5NX | ![]() |
0.221 | ||
ENC004972 | ![]() |
0.640 | D0E1XL | ![]() |
0.217 | ||
ENC005972 | ![]() |
0.615 | D0S8LV | ![]() |
0.212 | ||
ENC005846 | ![]() |
0.615 | D0P7VJ | ![]() |
0.211 | ||
ENC002258 | ![]() |
0.609 | D0N4EC | ![]() |
0.210 |