![]() |
Name |
Periconiasin D
|
Molecular Formula | C22H33NO3 | |
IUPAC Name* |
(1S,2S,5S,6R,7S,10S,12R,16S)-1-hydroxy-7,8,12-trimethyl-5-(2-methylpropyl)-13-oxa-4-azapentacyclo[12.2.1.02,6.02,10.012,16]heptadec-8-en-3-one
|
|
SMILES |
C[C@H]1[C@H]2[C@@H](NC(=O)[C@@]23[C@@H](C[C@@]4([C@@H]5[C@]3(CC(C5)O4)O)C)C=C1C)CC(C)C
|
|
InChI |
InChI=1S/C22H33NO3/c1-11(2)6-16-18-13(4)12(3)7-14-9-20(5)17-8-15(26-20)10-21(17,25)22(14,18)19(24)23-16/h7,11,13-18,25H,6,8-10H2,1-5H3,(H,23,24)/t13-,14-,15?,16+,17-,18+,20-,21+,22-/m1/s1
|
|
InChIKey |
MWUDXCKYFLGDEF-PQWFSCETSA-N
|
|
Synonyms |
Periconiasin D; J3.567.282F
|
|
CAS | NA | |
PubChem CID | 132577309 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 359.5 | ALogp: | 2.3 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.6 | Aromatic Rings: | 5 |
Heavy Atoms: | 26 | QED Weighted: | 0.737 |
Caco-2 Permeability: | -5.049 | MDCK Permeability: | 0.00006660 |
Pgp-inhibitor: | 0.27 | Pgp-substrate: | 0.993 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.629 |
30% Bioavailability (F30%): | 0.122 |
Blood-Brain-Barrier Penetration (BBB): | 0.9 | Plasma Protein Binding (PPB): | 79.47% |
Volume Distribution (VD): | 1.214 | Fu: | 6.12% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.619 |
CYP2C19-inhibitor: | 0.2 | CYP2C19-substrate: | 0.795 |
CYP2C9-inhibitor: | 0.102 | CYP2C9-substrate: | 0.035 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.119 |
CYP3A4-inhibitor: | 0.828 | CYP3A4-substrate: | 0.359 |
Clearance (CL): | 14.208 | Half-life (T1/2): | 0.072 |
hERG Blockers: | 0.09 | Human Hepatotoxicity (H-HT): | 0.487 |
Drug-inuced Liver Injury (DILI): | 0.214 | AMES Toxicity: | 0.315 |
Rat Oral Acute Toxicity: | 0.947 | Maximum Recommended Daily Dose: | 0.907 |
Skin Sensitization: | 0.472 | Carcinogencity: | 0.917 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.021 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003806 | ![]() |
0.602 | D0E9KA | ![]() |
0.244 | ||
ENC003433 | ![]() |
0.549 | D0D2TN | ![]() |
0.241 | ||
ENC005824 | ![]() |
0.485 | D0W2EK | ![]() |
0.241 | ||
ENC005825 | ![]() |
0.400 | D03IKT | ![]() |
0.237 | ||
ENC002049 | ![]() |
0.396 | D0F1EX | ![]() |
0.237 | ||
ENC005136 | ![]() |
0.394 | D08PIQ | ![]() |
0.231 | ||
ENC005810 | ![]() |
0.394 | D0Y2YP | ![]() |
0.230 | ||
ENC004462 | ![]() |
0.393 | D04SFH | ![]() |
0.230 | ||
ENC004242 | ![]() |
0.393 | D02JNM | ![]() |
0.224 | ||
ENC002636 | ![]() |
0.393 | D04QNO | ![]() |
0.217 |