|
Name |
(5S,9E,11S,14S,15R,16S)-5-hydroxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,6,18-trione
|
| Molecular Formula | C24H35NO4 | |
| IUPAC Name* |
(5S,9E,11S,14S,15R,16S)-5-hydroxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,6,18-trione
|
|
| SMILES |
C[C@H]1[C@H]2[C@@H](NC(=O)C23[C@@H](/C=C(/CCC(=O)[C@H](CCC3=O)O)\C)C=C1C)CC(C)C
|
|
| InChI |
InChI=1S/C24H35NO4/c1-13(2)10-18-22-16(5)15(4)12-17-11-14(3)6-7-19(26)20(27)8-9-21(28)24(17,22)23(29)25-18/h11-13,16-18,20,22,27H,6-10H2,1-5H3,(H,25,29)/b14-11+/t16-,17+,18+,20+,22+,24?/m1/s1
|
|
| InChIKey |
GBCXTRJHTIEBIA-KFMQVBLSSA-N
|
|
| Synonyms |
Aspochalasin M
|
|
| CAS | NA | |
| PubChem CID | 163285906 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 401.5 | ALogp: | 2.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.5 | Aromatic Rings: | 3 |
| Heavy Atoms: | 29 | QED Weighted: | 0.538 |
| Caco-2 Permeability: | -4.794 | MDCK Permeability: | 0.00002970 |
| Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.071 |
| 30% Bioavailability (F30%): | 0.642 |
| Blood-Brain-Barrier Penetration (BBB): | 0.984 | Plasma Protein Binding (PPB): | 86.41% |
| Volume Distribution (VD): | 0.56 | Fu: | 10.75% |
| CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.336 |
| CYP2C19-inhibitor: | 0.511 | CYP2C19-substrate: | 0.835 |
| CYP2C9-inhibitor: | 0.251 | CYP2C9-substrate: | 0.329 |
| CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.124 |
| CYP3A4-inhibitor: | 0.848 | CYP3A4-substrate: | 0.38 |
| Clearance (CL): | 14.579 | Half-life (T1/2): | 0.291 |
| hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.248 |
| Drug-inuced Liver Injury (DILI): | 0.079 | AMES Toxicity: | 0.199 |
| Rat Oral Acute Toxicity: | 0.499 | Maximum Recommended Daily Dose: | 0.699 |
| Skin Sensitization: | 0.243 | Carcinogencity: | 0.829 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.879 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002636 | ![]() |
0.950 | D09PJX | ![]() |
0.246 | ||
| ENC005810 | ![]() |
0.767 | D0D2TN | ![]() |
0.238 | ||
| ENC003740 | ![]() |
0.731 | D06YFA | ![]() |
0.231 | ||
| ENC001855 | ![]() |
0.714 | D0W2EK | ![]() |
0.229 | ||
| ENC004242 | ![]() |
0.625 | D0I5DS | ![]() |
0.228 | ||
| ENC005136 | ![]() |
0.606 | D05AFC | ![]() |
0.222 | ||
| ENC005825 | ![]() |
0.594 | D0K7LU | ![]() |
0.221 | ||
| ENC002049 | ![]() |
0.486 | D09WYX | ![]() |
0.221 | ||
| ENC003433 | ![]() |
0.480 | D04SFH | ![]() |
0.217 | ||
| ENC005824 | ![]() |
0.441 | D0L7LC | ![]() |
0.214 | ||