NPs Basic Information
|
Name |
Anteaglonialide C
|
| Molecular Formula | C20H20O5 | |
| IUPAC Name* |
(5R)-5-[(1'S,5'S)-5'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,2'-cyclohexane]-1'-yl]oxolan-2-one
|
|
| SMILES |
C1CC(=O)O[C@H]1[C@@H]2C[C@H](CCC23OC4=CC=CC5=C4C(=CC=C5)O3)O
|
|
| InChI |
InChI=1S/C20H20O5/c21-13-9-10-20(14(11-13)15-7-8-18(22)23-15)24-16-5-1-3-12-4-2-6-17(25-20)19(12)16/h1-6,13-15,21H,7-11H2/t13-,14-,15+/m0/s1
|
|
| InChIKey |
RNRMZVIOCXVWBX-SOUVJXGZSA-N
|
|
| Synonyms |
Anteaglonialide C; J3.514.332G
|
|
| CAS | NA | |
| PubChem CID | 132560713 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 340.4 | ALogp: | 3.4 |
| HBD: | 1 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 65.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 25 | QED Weighted: | 0.796 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.841 | MDCK Permeability: | 0.00004060 |
| Pgp-inhibitor: | 0.696 | Pgp-substrate: | 0.725 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.008 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.695 | Plasma Protein Binding (PPB): | 96.26% |
| Volume Distribution (VD): | 0.896 | Fu: | 2.46% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.685 | CYP1A2-substrate: | 0.126 |
| CYP2C19-inhibitor: | 0.847 | CYP2C19-substrate: | 0.149 |
| CYP2C9-inhibitor: | 0.636 | CYP2C9-substrate: | 0.832 |
| CYP2D6-inhibitor: | 0.083 | CYP2D6-substrate: | 0.192 |
| CYP3A4-inhibitor: | 0.763 | CYP3A4-substrate: | 0.312 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 12.568 | Half-life (T1/2): | 0.449 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.251 | Human Hepatotoxicity (H-HT): | 0.922 |
| Drug-inuced Liver Injury (DILI): | 0.104 | AMES Toxicity: | 0.54 |
| Rat Oral Acute Toxicity: | 0.121 | Maximum Recommended Daily Dose: | 0.932 |
| Skin Sensitization: | 0.903 | Carcinogencity: | 0.915 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.059 |
| Respiratory Toxicity: | 0.882 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003412 |  |
1.000 | D04JHN |  |
0.255 | ||
| ENC003411 |  |
0.741 | D00ZFP |  |
0.250 | ||
| ENC003415 |  |
0.738 | D08CCE |  |
0.243 | ||
| ENC003414 |  |
0.678 | D0C7JF |  |
0.239 | ||
| ENC003345 |  |
0.604 | D0Z1UA |  |
0.238 | ||
| ENC003417 |  |
0.593 | D0V4WD |  |
0.237 | ||
| ENC005581 |  |
0.571 | D0X5KF |  |
0.236 | ||
| ENC003288 |  |
0.526 | D00JRA |  |
0.236 | ||
| ENC003761 |  |
0.521 | D06ZEE |  |
0.235 | ||
| ENC003289 |  |
0.510 | D0Z1FX |  |
0.234 | ||