NPs Basic Information
|
Name |
Anteaglonialide F
|
| Molecular Formula | C20H16O5 | |
| IUPAC Name* |
(5'S)-5'-[(2R)-5-oxooxolan-2-yl]spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-cyclohex-2-ene]-1'-one
|
|
| SMILES |
C1CC(=O)O[C@H]1[C@@H]2CC(=O)C=CC23OC4=CC=CC5=C4C(=CC=C5)O3
|
|
| InChI |
InChI=1S/C20H16O5/c21-13-9-10-20(14(11-13)15-7-8-18(22)23-15)24-16-5-1-3-12-4-2-6-17(25-20)19(12)16/h1-6,9-10,14-15H,7-8,11H2/t14-,15+/m0/s1
|
|
| InChIKey |
MBHNJSJYNWLBSY-LSDHHAIUSA-N
|
|
| Synonyms |
Anteaglonialide F; CHEMBL3740953; J3.514.335A
|
|
| CAS | NA | |
| PubChem CID | 127038008 | |
| ChEMBL ID | CHEMBL3740953 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 336.3 | ALogp: | 3.0 |
| HBD: | 0 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 61.8 | Aromatic Rings: | 5 |
| Heavy Atoms: | 25 | QED Weighted: | 0.738 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.802 | MDCK Permeability: | 0.00003250 |
| Pgp-inhibitor: | 0.936 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.039 |
| 30% Bioavailability (F30%): | 0.235 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.288 | Plasma Protein Binding (PPB): | 96.59% |
| Volume Distribution (VD): | 0.53 | Fu: | 3.16% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.789 | CYP1A2-substrate: | 0.102 |
| CYP2C19-inhibitor: | 0.892 | CYP2C19-substrate: | 0.107 |
| CYP2C9-inhibitor: | 0.772 | CYP2C9-substrate: | 0.702 |
| CYP2D6-inhibitor: | 0.907 | CYP2D6-substrate: | 0.158 |
| CYP3A4-inhibitor: | 0.878 | CYP3A4-substrate: | 0.291 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 7.777 | Half-life (T1/2): | 0.646 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.245 | Human Hepatotoxicity (H-HT): | 0.957 |
| Drug-inuced Liver Injury (DILI): | 0.64 | AMES Toxicity: | 0.966 |
| Rat Oral Acute Toxicity: | 0.831 | Maximum Recommended Daily Dose: | 0.84 |
| Skin Sensitization: | 0.785 | Carcinogencity: | 0.922 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.031 |
| Respiratory Toxicity: | 0.934 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003414 |  |
0.738 | D08CCE |  |
0.267 | ||
| ENC003415 |  |
0.678 | D05MQK |  |
0.266 | ||
| ENC003413 |  |
0.604 | D06ZEE |  |
0.256 | ||
| ENC003412 |  |
0.604 | D00JRA |  |
0.248 | ||
| ENC001972 |  |
0.576 | D09WKB |  |
0.245 | ||
| ENC003416 |  |
0.543 | D08FTG |  |
0.245 | ||
| ENC002537 |  |
0.527 | D0G3AQ |  |
0.241 | ||
| ENC001947 |  |
0.505 | D06TJJ |  |
0.239 | ||
| ENC003411 |  |
0.495 | D0O6IZ |  |
0.235 | ||
| ENC002531 |  |
0.495 | D09IOI |  |
0.232 | ||