![]() |
Name |
Talarolutin A
|
Molecular Formula | C21H30O5 | |
IUPAC Name* |
(1R,2S,5R,7S,10R,14R)-5-hydroxy-2,6,6,10,14-pentamethyl-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadec-12(17)-ene-3,16-dione
|
|
SMILES |
C[C@@H]1CC(=O)C2=C(O1)O[C@@]3(CC[C@@H]4[C@@]([C@H]3C2)(C(=O)C[C@H](C4(C)C)O)C)C
|
|
InChI |
InChI=1S/C21H30O5/c1-11-8-13(22)12-9-15-20(4,26-18(12)25-11)7-6-14-19(2,3)16(23)10-17(24)21(14,15)5/h11,14-16,23H,6-10H2,1-5H3/t11-,14+,15+,16-,20-,21+/m1/s1
|
|
InChIKey |
WNQOWPFARWIGAD-BXHXOAHLSA-N
|
|
Synonyms |
Talarolutin A; J3.580.494C
|
|
CAS | NA | |
PubChem CID | 132529125 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 362.5 | ALogp: | 2.3 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 72.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.707 |
Caco-2 Permeability: | -4.703 | MDCK Permeability: | 0.00005070 |
Pgp-inhibitor: | 0.918 | Pgp-substrate: | 0.081 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.209 |
30% Bioavailability (F30%): | 0.957 |
Blood-Brain-Barrier Penetration (BBB): | 0.958 | Plasma Protein Binding (PPB): | 60.49% |
Volume Distribution (VD): | 0.561 | Fu: | 45.69% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.513 |
CYP2C9-inhibitor: | 0.044 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.038 |
CYP3A4-inhibitor: | 0.286 | CYP3A4-substrate: | 0.603 |
Clearance (CL): | 7.384 | Half-life (T1/2): | 0.33 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.365 |
Drug-inuced Liver Injury (DILI): | 0.151 | AMES Toxicity: | 0.021 |
Rat Oral Acute Toxicity: | 0.971 | Maximum Recommended Daily Dose: | 0.969 |
Skin Sensitization: | 0.566 | Carcinogencity: | 0.633 |
Eye Corrosion: | 0.019 | Eye Irritation: | 0.05 |
Respiratory Toxicity: | 0.978 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003407 | ![]() |
0.707 | D0W2EK | ![]() |
0.281 | ||
ENC003408 | ![]() |
0.571 | D06IIB | ![]() |
0.262 | ||
ENC003409 | ![]() |
0.556 | D0G6AB | ![]() |
0.257 | ||
ENC002748 | ![]() |
0.400 | D0C7JF | ![]() |
0.257 | ||
ENC002750 | ![]() |
0.375 | D0G8BV | ![]() |
0.252 | ||
ENC002749 | ![]() |
0.374 | D0Q6NZ | ![]() |
0.248 | ||
ENC001452 | ![]() |
0.368 | D0D2VS | ![]() |
0.248 | ||
ENC001980 | ![]() |
0.360 | D0U3GL | ![]() |
0.248 | ||
ENC003566 | ![]() |
0.352 | D0P0HT | ![]() |
0.246 | ||
ENC002407 | ![]() |
0.337 | D0D2TN | ![]() |
0.243 |