![]() |
Name |
Biatriosporin M
|
Molecular Formula | C10H12O4 | |
IUPAC Name* |
(3R,4aS,5R)-5,8-dihydroxy-3-methyl-3,4,4a,5-tetrahydroisochromen-1-one
|
|
SMILES |
C[C@@H]1C[C@@H]2[C@@H](C=CC(=C2C(=O)O1)O)O
|
|
InChI |
InChI=1S/C10H12O4/c1-5-4-6-7(11)2-3-8(12)9(6)10(13)14-5/h2-3,5-7,11-12H,4H2,1H3/t5-,6-,7-/m1/s1
|
|
InChIKey |
LILRKZYCRFCTHF-FSDSQADBSA-N
|
|
Synonyms |
Biatriosporin M; CHEMBL3924958; J3.552.732J
|
|
CAS | NA | |
PubChem CID | 132523654 | |
ChEMBL ID | CHEMBL3924958 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 196.2 | ALogp: | 0.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.569 |
Caco-2 Permeability: | -4.836 | MDCK Permeability: | 0.00000991 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.029 | 20% Bioavailability (F20%): | 0.2 |
30% Bioavailability (F30%): | 0.958 |
Blood-Brain-Barrier Penetration (BBB): | 0.114 | Plasma Protein Binding (PPB): | 50.92% |
Volume Distribution (VD): | 1.717 | Fu: | 38.87% |
CYP1A2-inhibitor: | 0.087 | CYP1A2-substrate: | 0.684 |
CYP2C19-inhibitor: | 0.044 | CYP2C19-substrate: | 0.732 |
CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.842 |
CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.412 |
CYP3A4-inhibitor: | 0.012 | CYP3A4-substrate: | 0.17 |
Clearance (CL): | 8.499 | Half-life (T1/2): | 0.884 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.15 |
Drug-inuced Liver Injury (DILI): | 0.16 | AMES Toxicity: | 0.675 |
Rat Oral Acute Toxicity: | 0.647 | Maximum Recommended Daily Dose: | 0.509 |
Skin Sensitization: | 0.783 | Carcinogencity: | 0.648 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.824 |
Respiratory Toxicity: | 0.762 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005043 | ![]() |
0.520 | D0CL9S | ![]() |
0.235 | ||
ENC004882 | ![]() |
0.500 | D0K7LU | ![]() |
0.225 | ||
ENC002454 | ![]() |
0.407 | D0WE3O | ![]() |
0.225 | ||
ENC001433 | ![]() |
0.382 | D03KXY | ![]() |
0.221 | ||
ENC004916 | ![]() |
0.368 | D0R2KF | ![]() |
0.219 | ||
ENC002508 | ![]() |
0.362 | D09PZO | ![]() |
0.217 | ||
ENC004795 | ![]() |
0.345 | D0TS1Z | ![]() |
0.217 | ||
ENC003459 | ![]() |
0.345 | D07AHW | ![]() |
0.211 | ||
ENC002098 | ![]() |
0.344 | D0X5XU | ![]() |
0.206 | ||
ENC002200 | ![]() |
0.344 | D0A2AJ | ![]() |
0.205 |