![]() |
Name |
Modiolide A
|
Molecular Formula | C10H14O4 | |
IUPAC Name* |
(2R,4S,5E,7R,8Z)-4,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one
|
|
SMILES |
C[C@@H]1C[C@@H](/C=C/[C@H](/C=C\C(=O)O1)O)O
|
|
InChI |
InChI=1S/C10H14O4/c1-7-6-9(12)3-2-8(11)4-5-10(13)14-7/h2-5,7-9,11-12H,6H2,1H3/b3-2+,5-4-/t7-,8-,9-/m1/s1
|
|
InChIKey |
MKPZLFSGCUYQEY-JKPBTABPSA-N
|
|
Synonyms |
Modiolide A; (2R,4S,5E,7R,8Z)-4,7-dihydroxy-2-methyl-2,3,4,7-tetrahydrooxecin-10-one; 5,8-dihydroxy-10-methyl-5,8,9,10-tetrahydro-2H-oxecin-2-one; CHEMBL517659; SCHEMBL15516225; CHEBI:190592; ZINC14594569
|
|
CAS | NA | |
PubChem CID | 643697 | |
ChEMBL ID | CHEMBL517659 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 198.22 | ALogp: | 0.3 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.441 |
Caco-2 Permeability: | -4.514 | MDCK Permeability: | 0.00003110 |
Pgp-inhibitor: | 0.967 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.015 |
Blood-Brain-Barrier Penetration (BBB): | 0.857 | Plasma Protein Binding (PPB): | 43.88% |
Volume Distribution (VD): | 0.316 | Fu: | 76.32% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.085 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.057 |
CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.7 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.713 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.166 |
Clearance (CL): | 6.651 | Half-life (T1/2): | 0.938 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.249 |
Drug-inuced Liver Injury (DILI): | 0.508 | AMES Toxicity: | 0.867 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.212 |
Skin Sensitization: | 0.087 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.792 | Eye Irritation: | 0.458 |
Respiratory Toxicity: | 0.03 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003825 | ![]() |
0.615 | D0R9VR | ![]() |
0.210 | ||
ENC003827 | ![]() |
0.615 | D0WE3O | ![]() |
0.210 | ||
ENC003826 | ![]() |
0.615 | D03KXY | ![]() |
0.203 | ||
ENC002189 | ![]() |
0.574 | D0CL9S | ![]() |
0.200 | ||
ENC003467 | ![]() |
0.571 | D02FEM | ![]() |
0.200 | ||
ENC003465 | ![]() |
0.571 | D06WTZ | ![]() |
0.192 | ||
ENC005407 | ![]() |
0.571 | D0K7LU | ![]() |
0.192 | ||
ENC003131 | ![]() |
0.571 | D0Z8EX | ![]() |
0.188 | ||
ENC001432 | ![]() |
0.571 | D0X5XU | ![]() |
0.188 | ||
ENC002454 | ![]() |
0.551 | D03DIG | ![]() |
0.188 |