|
Name |
Preussilide F
|
| Molecular Formula | C26H34O4 | |
| IUPAC Name* |
methyl (2E,4E,6E)-7-[(1R,6R,8S,8aS)-3,6,8-trimethyl-7-oxo-2-(2-oxopropyl)-5,6,8,8a-tetrahydro-1H-naphthalen-1-yl]-4,6-dimethylhepta-2,4,6-trienoate
|
|
| SMILES |
C[C@@H]1CC2=CC(=C([C@@H]([C@H]2[C@@H](C1=O)C)/C=C(\C)/C=C(\C)/C=C/C(=O)OC)CC(=O)C)C
|
|
| InChI |
InChI=1S/C26H34O4/c1-15(8-9-24(28)30-7)10-16(2)11-23-22(14-19(5)27)17(3)12-21-13-18(4)26(29)20(6)25(21)23/h8-12,18,20,23,25H,13-14H2,1-7H3/b9-8+,15-10+,16-11+/t18-,20+,23+,25+/m1/s1
|
|
| InChIKey |
NPDRLDWBYQKWPG-GZYVUVHISA-N
|
|
| Synonyms |
Preussilide F; CHEMBL4126336; J3.662.985A
|
|
| CAS | NA | |
| PubChem CID | 132489957 | |
| ChEMBL ID | CHEMBL4126336 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 410.5 | ALogp: | 4.1 |
| HBD: | 0 | HBA: | 4 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 60.4 | Aromatic Rings: | 2 |
| Heavy Atoms: | 30 | QED Weighted: | 0.326 |
| Caco-2 Permeability: | -4.681 | MDCK Permeability: | 0.00001620 |
| Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.007 |
| Human Intestinal Absorption (HIA): | 0.271 | 20% Bioavailability (F20%): | 0.012 |
| 30% Bioavailability (F30%): | 0.077 |
| Blood-Brain-Barrier Penetration (BBB): | 0.72 | Plasma Protein Binding (PPB): | 94.53% |
| Volume Distribution (VD): | 2.518 | Fu: | 2.32% |
| CYP1A2-inhibitor: | 0.223 | CYP1A2-substrate: | 0.733 |
| CYP2C19-inhibitor: | 0.897 | CYP2C19-substrate: | 0.922 |
| CYP2C9-inhibitor: | 0.964 | CYP2C9-substrate: | 0.091 |
| CYP2D6-inhibitor: | 0.255 | CYP2D6-substrate: | 0.174 |
| CYP3A4-inhibitor: | 0.961 | CYP3A4-substrate: | 0.845 |
| Clearance (CL): | 12.405 | Half-life (T1/2): | 0.895 |
| hERG Blockers: | 0.538 | Human Hepatotoxicity (H-HT): | 0.829 |
| Drug-inuced Liver Injury (DILI): | 0.699 | AMES Toxicity: | 0.026 |
| Rat Oral Acute Toxicity: | 0.114 | Maximum Recommended Daily Dose: | 0.909 |
| Skin Sensitization: | 0.966 | Carcinogencity: | 0.157 |
| Eye Corrosion: | 0.024 | Eye Irritation: | 0.021 |
| Respiratory Toxicity: | 0.966 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003386 | ![]() |
0.847 | D0B1IP | ![]() |
0.293 | ||
| ENC003387 | ![]() |
0.847 | D05QDC | ![]() |
0.274 | ||
| ENC003388 | ![]() |
0.798 | D00DKK | ![]() |
0.230 | ||
| ENC003384 | ![]() |
0.670 | D02DGU | ![]() |
0.230 | ||
| ENC003385 | ![]() |
0.635 | D0G3PI | ![]() |
0.230 | ||
| ENC003854 | ![]() |
0.343 | D0A7MY | ![]() |
0.218 | ||
| ENC003853 | ![]() |
0.343 | D0V2JK | ![]() |
0.203 | ||
| ENC004635 | ![]() |
0.263 | D0E9KA | ![]() |
0.200 | ||
| ENC005985 | ![]() |
0.262 | D0FG6M | ![]() |
0.196 | ||
| ENC005662 | ![]() |
0.250 | D0G7KJ | ![]() |
0.193 | ||