|
Name |
Preussilide A
|
| Molecular Formula | C25H34O4 | |
| IUPAC Name* |
(2E,4E,6E)-7-[(1R,6R,8S,8aS)-2-[(2S)-2-hydroxypropyl]-3,6,8-trimethyl-7-oxo-5,6,8,8a-tetrahydro-1H-naphthalen-1-yl]-4,6-dimethylhepta-2,4,6-trienoic acid
|
|
| SMILES |
C[C@@H]1CC2=CC(=C([C@@H]([C@H]2[C@@H](C1=O)C)/C=C(\C)/C=C(\C)/C=C/C(=O)O)C[C@H](C)O)C
|
|
| InChI |
InChI=1S/C25H34O4/c1-14(7-8-23(27)28)9-15(2)10-22-21(13-18(5)26)16(3)11-20-12-17(4)25(29)19(6)24(20)22/h7-11,17-19,22,24,26H,12-13H2,1-6H3,(H,27,28)/b8-7+,14-9+,15-10+/t17-,18+,19+,22+,24+/m1/s1
|
|
| InChIKey |
LMSUWCOEKCRCEB-XYOUVAGFSA-N
|
|
| Synonyms |
Preussilide A; CHEMBL4127416; J3.662.980K
|
|
| CAS | NA | |
| PubChem CID | 132489952 | |
| ChEMBL ID | CHEMBL4127416 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 398.5 | ALogp: | 4.2 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 74.6 | Aromatic Rings: | 2 |
| Heavy Atoms: | 29 | QED Weighted: | 0.466 |
| Caco-2 Permeability: | -4.768 | MDCK Permeability: | 0.00000904 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.865 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.001 |
| Blood-Brain-Barrier Penetration (BBB): | 0.144 | Plasma Protein Binding (PPB): | 96.42% |
| Volume Distribution (VD): | 0.745 | Fu: | 2.97% |
| CYP1A2-inhibitor: | 0.136 | CYP1A2-substrate: | 0.107 |
| CYP2C19-inhibitor: | 0.074 | CYP2C19-substrate: | 0.357 |
| CYP2C9-inhibitor: | 0.257 | CYP2C9-substrate: | 0.967 |
| CYP2D6-inhibitor: | 0.062 | CYP2D6-substrate: | 0.208 |
| CYP3A4-inhibitor: | 0.033 | CYP3A4-substrate: | 0.243 |
| Clearance (CL): | 7.105 | Half-life (T1/2): | 0.837 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.207 |
| Drug-inuced Liver Injury (DILI): | 0.95 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.919 | Maximum Recommended Daily Dose: | 0.889 |
| Skin Sensitization: | 0.915 | Carcinogencity: | 0.855 |
| Eye Corrosion: | 0.025 | Eye Irritation: | 0.04 |
| Respiratory Toxicity: | 0.98 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003388 | ![]() |
0.847 | D05QDC | ![]() |
0.294 | ||
| ENC003387 | ![]() |
0.791 | D02DGU | ![]() |
0.271 | ||
| ENC003386 | ![]() |
0.791 | D0G3PI | ![]() |
0.271 | ||
| ENC003389 | ![]() |
0.670 | D00DKK | ![]() |
0.271 | ||
| ENC003385 | ![]() |
0.621 | D0B1IP | ![]() |
0.256 | ||
| ENC003852 | ![]() |
0.296 | D0N3NO | ![]() |
0.218 | ||
| ENC005575 | ![]() |
0.270 | D0O5FY | ![]() |
0.217 | ||
| ENC003895 | ![]() |
0.270 | D0E9KA | ![]() |
0.214 | ||
| ENC006058 | ![]() |
0.268 | D0S7WX | ![]() |
0.207 | ||
| ENC006057 | ![]() |
0.268 | D0W2EK | ![]() |
0.204 | ||