|
Name |
3',4,4'-Trihydroxypulvinone
|
| Molecular Formula | C17H12O6 | |
| IUPAC Name* |
(5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-4-hydroxy-3-(4-hydroxyphenyl)furan-2-one
|
|
| SMILES |
C1=CC(=CC=C1C2=C(/C(=C/C3=CC(=C(C=C3)O)O)/OC2=O)O)O
|
|
| InChI |
InChI=1S/C17H12O6/c18-11-4-2-10(3-5-11)15-16(21)14(23-17(15)22)8-9-1-6-12(19)13(20)7-9/h1-8,18-21H/b14-8-
|
|
| InChIKey |
ZGCIQJGTALTNIG-ZSOIEALJSA-N
|
|
| Synonyms |
3',4,4'-Trihydroxypulvinone; CHEMBL4169066; CHEBI:174244; alpha-((2-(Dibutylamino)ethoxy)methyl)-Benzyl alcohol; (5Z)-5-[(3,4-dihydroxyphenyl)methylene]-4-hydroxy-3-(4-hydroxyphenyl)furan-2-one; (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-4-hydroxy-3-(4-hydroxyphenyl)uran-2-one; 5-[(3,4-Dihydroxyphenyl)methylene]-4-hydroxy-3-(4-hydroxyphenyl)-2(5H)-furanone, 9CI
|
|
| CAS | 51282-12-3 | |
| PubChem CID | 131751048 | |
| ChEMBL ID | CHEMBL4169066 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 312.27 | ALogp: | 2.3 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 23 | QED Weighted: | 0.5 |
| Caco-2 Permeability: | -4.995 | MDCK Permeability: | 0.00001880 |
| Pgp-inhibitor: | 0.034 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.966 |
| 30% Bioavailability (F30%): | 0.088 |
| Blood-Brain-Barrier Penetration (BBB): | 0.028 | Plasma Protein Binding (PPB): | 94.27% |
| Volume Distribution (VD): | 0.434 | Fu: | 11.45% |
| CYP1A2-inhibitor: | 0.385 | CYP1A2-substrate: | 0.082 |
| CYP2C19-inhibitor: | 0.224 | CYP2C19-substrate: | 0.056 |
| CYP2C9-inhibitor: | 0.574 | CYP2C9-substrate: | 0.899 |
| CYP2D6-inhibitor: | 0.154 | CYP2D6-substrate: | 0.283 |
| CYP3A4-inhibitor: | 0.815 | CYP3A4-substrate: | 0.226 |
| Clearance (CL): | 9.024 | Half-life (T1/2): | 0.811 |
| hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.202 |
| Drug-inuced Liver Injury (DILI): | 0.672 | AMES Toxicity: | 0.241 |
| Rat Oral Acute Toxicity: | 0.419 | Maximum Recommended Daily Dose: | 0.18 |
| Skin Sensitization: | 0.679 | Carcinogencity: | 0.198 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.575 |
| Respiratory Toxicity: | 0.147 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005410 | ![]() |
0.795 | D04AIT | ![]() |
0.435 | ||
| ENC002800 | ![]() |
0.726 | D0K8KX | ![]() |
0.409 | ||
| ENC003492 | ![]() |
0.705 | D06KYN | ![]() |
0.372 | ||
| ENC005411 | ![]() |
0.600 | D0J7RK | ![]() |
0.370 | ||
| ENC001557 | ![]() |
0.506 | D06TJJ | ![]() |
0.347 | ||
| ENC002756 | ![]() |
0.478 | D0V9EN | ![]() |
0.320 | ||
| ENC000822 | ![]() |
0.477 | D0U3YB | ![]() |
0.319 | ||
| ENC001548 | ![]() |
0.470 | D0R6BI | ![]() |
0.295 | ||
| ENC005039 | ![]() |
0.462 | D04XEG | ![]() |
0.289 | ||
| ENC003356 | ![]() |
0.448 | D07MGA | ![]() |
0.289 | ||